1,5-Dihydroxy-2-methoxyxanthone
| Internal ID | 9efcbb99-ab98-4498-8ed7-d6702b172a9c |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1,5-dihydroxy-2-methoxyxanthen-9-one |
| SMILES (Canonical) | COC1=C(C2=C(C=C1)OC3=C(C2=O)C=CC=C3O)O |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1)OC3=C(C2=O)C=CC=C3O)O |
| InChI | InChI=1S/C14H10O5/c1-18-10-6-5-9-11(13(10)17)12(16)7-3-2-4-8(15)14(7)19-9/h2-6,15,17H,1H3 |
| InChI Key | IWDZOJJDTFMEHP-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 2.80 |
| IWDZOJJDTFMEHP-UHFFFAOYSA-N |
| 1,5-Dihydroxy-2-methoxy-9H-xanthen-9-one # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.74% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.99% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.98% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.56% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.79% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.15% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.25% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.18% | 98.75% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.59% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.51% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.21% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.02% | 94.73% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.78% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.65% | 85.14% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.05% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.94% | 95.89% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 80.55% | 98.11% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.45% | 95.50% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.30% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hypericum beanii |
| Hypericum sampsonii |
| PubChem | 5377509 |
| LOTUS | LTS0099329 |
| wikiData | Q105121536 |