[1,5-Bis(hydroxymethyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol
| Internal ID | acfd5c7f-3805-4d62-89be-fcd3a4f2ba14 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Primary alcohols |
| IUPAC Name | [1,5-bis(hydroxymethyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol |
| SMILES (Canonical) | CC1(CCCC2(C1CCC(=C2CO)CO)C)CO |
| SMILES (Isomeric) | CC1(CCCC2(C1CCC(=C2CO)CO)C)CO |
| InChI | InChI=1S/C15H26O3/c1-14(10-18)6-3-7-15(2)12(9-17)11(8-16)4-5-13(14)15/h13,16-18H,3-10H2,1-2H3 |
| InChI Key | LXCQUISXGHAMOS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.18819469 g/mol |
| Topological Polar Surface Area (TPSA) | 60.70 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
![2D Structure of [1,5-Bis(hydroxymethyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol](https://plantaedb.com/storage/docs/compounds/2023/11/15-bishydroxymethyl-58a-dimethyl-344a678-hexahydronaphthalen-2-ylmethanol.jpg "2D Structure of [1,5-Bis(hydroxymethyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-yl]methanol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.11% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.31% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.33% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.21% | 95.93% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.61% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.56% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.94% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.71% | 95.89% |
| CHEMBL233 | P35372 | Mu opioid receptor | 83.63% | 97.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.94% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.92% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.76% | 92.62% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.91% | 97.50% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.52% | 95.38% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.24% | 82.69% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.00% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44715197 |
| LOTUS | LTS0198952 |
| wikiData | Q104171414 |