15-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)pentadeca-2,4,13-trienamide
Internal ID | d23131f8-98f8-4e88-befc-4a261bafcd26 |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | 15-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)pentadeca-2,4,13-trienamide |
SMILES (Canonical) | CC(C)CNC(=O)C=CC=CCCCCCCCC=CCC1=CC2=C(C=C1)OCO2 |
SMILES (Isomeric) | CC(C)CNC(=O)C=CC=CCCCCCCCC=CCC1=CC2=C(C=C1)OCO2 |
InChI | InChI=1S/C26H37NO3/c1-22(2)20-27-26(28)16-14-12-10-8-6-4-3-5-7-9-11-13-15-23-17-18-24-25(19-23)30-21-29-24/h10-14,16-19,22H,3-9,15,20-21H2,1-2H3,(H,27,28) |
InChI Key | UJRIYGLYYIVULW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H37NO3 |
Molecular Weight | 411.60 g/mol |
Exact Mass | 411.27734404 g/mol |
Topological Polar Surface Area (TPSA) | 47.60 Ų |
XlogP | 7.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.92% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.62% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.27% | 91.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 97.12% | 94.80% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.72% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.47% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.78% | 94.73% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.50% | 96.77% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.36% | 90.24% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 91.20% | 92.95% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 91.03% | 80.96% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.72% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.35% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.61% | 90.71% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 83.76% | 85.30% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.39% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.90% | 96.95% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 81.85% | 92.51% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.56% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.81% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper mullesua |
PubChem | 78384607 |
LOTUS | LTS0244930 |
wikiData | Q105274130 |