15-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)pentadeca-2,4,12-trienamide
Internal ID | d9bf7ffd-3c9e-440f-8cff-a6e1481c998a |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | 15-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)pentadeca-2,4,12-trienamide |
SMILES (Canonical) | CC(C)CNC(=O)C=CC=CCCCCCCC=CCCC1=CC2=C(C=C1)OCO2 |
SMILES (Isomeric) | CC(C)CNC(=O)C=CC=CCCCCCCC=CCCC1=CC2=C(C=C1)OCO2 |
InChI | InChI=1S/C26H37NO3/c1-22(2)20-27-26(28)16-14-12-10-8-6-4-3-5-7-9-11-13-15-23-17-18-24-25(19-23)30-21-29-24/h9-12,14,16-19,22H,3-8,13,15,20-21H2,1-2H3,(H,27,28) |
InChI Key | HWFAZYWAXLPNDY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H37NO3 |
Molecular Weight | 411.60 g/mol |
Exact Mass | 411.27734404 g/mol |
Topological Polar Surface Area (TPSA) | 47.60 Ų |
XlogP | 7.40 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.04% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.69% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.39% | 91.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 97.63% | 94.80% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.74% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.60% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.53% | 94.73% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.20% | 96.77% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 91.81% | 80.96% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 90.53% | 92.95% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.27% | 90.24% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.51% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.46% | 96.00% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.94% | 85.30% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.67% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.10% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.68% | 86.33% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.37% | 89.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.34% | 92.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.69% | 96.95% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.42% | 89.34% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.02% | 89.00% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.30% | 85.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper ridleyi |
PubChem | 163076484 |
LOTUS | LTS0217395 |
wikiData | Q105034634 |