(3S,8S,9S,10R,13S,14S,17R)-3-[(2R,3R,4S,5S,6R)-4-hydroxy-6-(hydroxymethyl)-3,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-2-yl]oxy-10,13-dimethyl-17-[(2S)-1-[(2R,4R,5S)-4-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]-1-oxopropan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one
Internal ID | 420184dc-0ce0-4f6a-801b-008eca5b0dc0 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | (3S,8S,9S,10R,13S,14S,17R)-3-[(2R,3R,4S,5S,6R)-4-hydroxy-6-(hydroxymethyl)-3,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-2-yl]oxy-10,13-dimethyl-17-[(2S)-1-[(2R,4R,5S)-4-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]-1-oxopropan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
SMILES (Canonical) | CC1CC(OC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)C(C)C3C(=O)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C |
SMILES (Isomeric) | C[C@@H]1C[C@@H](O[C@H]1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)C(=O)[C@@H](C)[C@H]3C(=O)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C |
InChI | InChI=1S/C51H80O23/c1-18-13-28(69-45(18)74-48-41(64)38(61)35(58)29(16-52)70-48)32(55)19(2)31-27(54)15-26-24-8-7-22-14-23(9-11-50(22,5)25(24)10-12-51(26,31)6)68-49-44(73-47-40(63)37(60)34(57)21(4)67-47)42(65)43(30(17-53)71-49)72-46-39(62)36(59)33(56)20(3)66-46/h7,18-21,23-26,28-31,33-49,52-53,56-65H,8-17H2,1-6H3/t18-,19+,20+,21+,23+,24-,25+,26+,28-,29-,30-,31+,33+,34+,35-,36-,37-,38+,39-,40-,41-,42+,43-,44-,45+,46+,47+,48+,49-,50+,51+/m1/s1 |
InChI Key | UIARJAYMUVTPIU-VPTAEHAASA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H80O23 |
Molecular Weight | 1061.20 g/mol |
Exact Mass | 1060.50903879 g/mol |
Topological Polar Surface Area (TPSA) | 360.00 Ų |
XlogP | -2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.54% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.44% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.85% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.42% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.31% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.90% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.16% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.90% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.35% | 94.75% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.21% | 92.50% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.08% | 90.08% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.89% | 95.89% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.84% | 96.77% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.02% | 93.56% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.45% | 95.56% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.87% | 98.10% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.59% | 95.89% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.67% | 89.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.36% | 86.33% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.28% | 93.04% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.18% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum anguivi |
PubChem | 162991156 |
LOTUS | LTS0171402 |
wikiData | Q105273207 |