2-[6-ethyl-2-hydroxy-5-(2-hydroxy-2-methylbutanoyl)oxan-2-yl]-N-[(6R,7S,10S,13S,14S,21R,24S)-10-ethyl-6,9,23-trihydroxy-29-[(2S,4S,5R,6S)-5-[(2S,4S,5R,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-24-(methoxymethyl)-6-methyl-2,8,11,15,22,25-hexaoxo-13-propan-2-yl-12-oxa-3,9,16,17,23,26,27-heptazatetracyclo[24.4.0.03,7.016,21]triacont-29-en-14-yl]-2-hydroxypropanamide
| Internal ID | f85b8fb1-43b8-4a00-9fb8-d0413468b8cc |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides > Cyclic glycodepsipeptides |
| IUPAC Name | 2-[6-ethyl-2-hydroxy-5-(2-hydroxy-2-methylbutanoyl)oxan-2-yl]-N-[(6R,7S,10S,13S,14S,21R,24S)-10-ethyl-6,9,23-trihydroxy-29-[(2S,4S,5R,6S)-5-[(2S,4S,5R,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-24-(methoxymethyl)-6-methyl-2,8,11,15,22,25-hexaoxo-13-propan-2-yl-12-oxa-3,9,16,17,23,26,27-heptazatetracyclo[24.4.0.03,7.016,21]triacont-29-en-14-yl]-2-hydroxypropanamide |
| SMILES (Canonical) | CCC1C(CCC(O1)(C(C)(C(=O)NC2C(OC(=O)C(N(C(=O)C3C(CCN3C(=O)C4C=C(CNN4C(=O)C(N(C(=O)C5CCCNN5C2=O)O)COC)OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)O)OC)OC)(C)O)O)CC)C(C)C)O)O)C(=O)C(C)(CC)O |
| SMILES (Isomeric) | CC[C@H]1C(=O)O[C@H]([C@@H](C(=O)N2[C@H](CCCN2)C(=O)N([C@H](C(=O)N3C(C=C(CN3)O[C@H]4C[C@@H]([C@@H]([C@@H](O4)C)O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O)OC)OC)C(=O)N6CC[C@@]([C@H]6C(=O)N1O)(C)O)COC)O)NC(=O)C(C)(C7(CCC(C(O7)CC)C(=O)C(C)(CC)O)O)O)C(C)C |
| InChI | InChI=1S/C59H96N8O24/c1-14-34-54(75)90-45(29(4)5)43(62-55(76)58(10,79)59(80)20-19-33(38(15-2)91-59)48(69)56(8,77)16-3)52(73)64-35(18-17-22-60-64)51(72)67(82)37(28-83-11)50(71)65-36(49(70)63-23-21-57(9,78)47(63)53(74)66(34)81)24-32(27-61-65)88-41-26-40(85-13)46(31(7)87-41)89-42-25-39(84-12)44(68)30(6)86-42/h24,29-31,33-47,60-61,68,77-82H,14-23,25-28H2,1-13H3,(H,62,76)/t30-,31-,33?,34-,35+,36?,37-,38?,39-,40-,41-,42-,43-,44+,45-,46+,47+,56?,57+,58?,59?/m0/s1 |
| InChI Key | RJMAMONPIIYLDD-XUEXKZAKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C59H96N8O24 |
| Molecular Weight | 1301.40 g/mol |
| Exact Mass | 1300.65374596 g/mol |
| Topological Polar Surface Area (TPSA) | 414.00 Ų |
| XlogP | -0.80 |
| Atomic LogP (AlogP) | -1.83 |
| H-Bond Acceptor | 26 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 17 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6144 | 61.44% |
| Caco-2 | - | 0.8589 | 85.89% |
| Blood Brain Barrier | - | 0.8750 | 87.50% |
| Human oral bioavailability | - | 0.8000 | 80.00% |
| Subcellular localzation | Lysosomes | 0.4436 | 44.36% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8133 | 81.33% |
| OATP1B3 inhibitior | + | 0.9245 | 92.45% |
| MATE1 inhibitior | - | 0.8800 | 88.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9646 | 96.46% |
| P-glycoprotein inhibitior | + | 0.7428 | 74.28% |
| P-glycoprotein substrate | + | 0.8585 | 85.85% |
| CYP3A4 substrate | + | 0.7580 | 75.80% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8733 | 87.33% |
| CYP3A4 inhibition | - | 0.7821 | 78.21% |
| CYP2C9 inhibition | - | 0.7603 | 76.03% |
| CYP2C19 inhibition | - | 0.7598 | 75.98% |
| CYP2D6 inhibition | - | 0.8780 | 87.80% |
| CYP1A2 inhibition | - | 0.8145 | 81.45% |
| CYP2C8 inhibition | + | 0.8109 | 81.09% |
| CYP inhibitory promiscuity | - | 0.9702 | 97.02% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.4683 | 46.83% |
| Eye corrosion | - | 0.9798 | 97.98% |
| Eye irritation | - | 0.8962 | 89.62% |
| Skin irritation | - | 0.7499 | 74.99% |
| Skin corrosion | - | 0.9147 | 91.47% |
| Ames mutagenesis | - | 0.5970 | 59.70% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7252 | 72.52% |
| Micronuclear | + | 0.7500 | 75.00% |
| Hepatotoxicity | + | 0.5875 | 58.75% |
| skin sensitisation | - | 0.8325 | 83.25% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.8875 | 88.75% |
| Nephrotoxicity | - | 0.8504 | 85.04% |
| Acute Oral Toxicity (c) | III | 0.6036 | 60.36% |
| Estrogen receptor binding | + | 0.5966 | 59.66% |
| Androgen receptor binding | + | 0.7724 | 77.24% |
| Thyroid receptor binding | + | 0.7465 | 74.65% |
| Glucocorticoid receptor binding | + | 0.8058 | 80.58% |
| Aromatase binding | + | 0.7273 | 72.73% |
| PPAR gamma | + | 0.8094 | 80.94% |
| Honey bee toxicity | - | 0.6053 | 60.53% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.5400 | 54.00% |
| Fish aquatic toxicity | + | 0.9021 | 90.21% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.78% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.39% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.04% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.59% | 98.95% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 97.57% | 91.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 97.50% | 95.89% |
| CHEMBL4072 | P07858 | Cathepsin B | 97.46% | 93.67% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.37% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.99% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.84% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.92% | 89.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.38% | 97.14% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 94.20% | 98.99% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 94.18% | 92.88% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.01% | 96.61% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 92.19% | 97.05% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 91.87% | 93.04% |
| CHEMBL1871 | P10275 | Androgen Receptor | 91.73% | 96.43% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.59% | 99.23% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 89.84% | 90.93% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.23% | 90.08% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.77% | 96.77% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.74% | 98.59% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.47% | 91.07% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 88.30% | 95.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.22% | 94.33% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.14% | 93.00% |
| CHEMBL5028 | O14672 | ADAM10 | 86.52% | 97.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.48% | 95.93% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.96% | 94.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.89% | 96.90% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.72% | 95.83% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.67% | 92.62% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 84.54% | 95.00% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 84.50% | 92.78% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.47% | 100.00% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 84.24% | 80.33% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.44% | 86.33% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.29% | 92.50% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.88% | 92.86% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.05% | 91.19% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.48% | 100.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.36% | 96.21% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.01% | 96.47% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.58% | 97.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.21% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 102230378 |
| LOTUS | LTS0005303 |
| wikiData | Q77565909 |