[10-[19-[12-(3,4,5,11,16,17,18-Heptahydroxy-8,13-dioxo-9,12-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,14,16-hexaen-10-yl)-3,4,5,17,18,19-hexahydroxy-8,14-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-6-yl]-2,3,4,7,8,9-hexahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1,3,5(18),6,8,10-hexaen-14-yl]-3,4,5,17,18,19-hexahydroxy-8,14-dioxo-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-11-yl] 3,4,5-trihydroxybenzoate
Internal ID | f8075fd2-19a6-4123-aae6-4845fd7b4a53 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [10-[19-[12-(3,4,5,11,16,17,18-heptahydroxy-8,13-dioxo-9,12-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,14,16-hexaen-10-yl)-3,4,5,17,18,19-hexahydroxy-8,14-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-6-yl]-2,3,4,7,8,9-hexahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1,3,5(18),6,8,10-hexaen-14-yl]-3,4,5,17,18,19-hexahydroxy-8,14-dioxo-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-11-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(C(OC(=O)C2=CC(=C(C(=C2C3=C(C(=C(C=C3C(=O)O1)O)O)O)O)O)O)C4C5C(C6=C(C(=C(C(=C6C(=O)O5)C7=C(C(=C(C=C7C(=O)O4)O)O)O)O)O)O)C8=C(C(=C(C9=C8C(=O)OCC(C(OC(=O)C1=CC(=C(C(=C19)O)O)O)C1C(OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O |
SMILES (Isomeric) | C1C(C(OC(=O)C2=CC(=C(C(=C2C3=C(C(=C(C=C3C(=O)O1)O)O)O)O)O)O)C4C5C(C6=C(C(=C(C(=C6C(=O)O5)C7=C(C(=C(C=C7C(=O)O4)O)O)O)O)O)O)C8=C(C(=C(C9=C8C(=O)OCC(C(OC(=O)C1=CC(=C(C(=C19)O)O)O)C1C(OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O |
InChI | InChI=1S/C81H54O51/c82-21-1-13(2-22(83)46(21)92)71(112)125-31-11-123-73(114)15-5-25(86)48(94)54(100)33(15)34-16(6-26(87)49(95)55(34)101)74(115)127-66(31)69-68-43(42-45(80(121)129-68)40(61(107)65(111)63(42)109)38-20(76(117)130-69)10-30(91)53(99)59(38)105)41-44-39(60(106)64(110)62(41)108)37-19(9-29(90)52(98)58(37)104)75(116)128-67(32(12-124-79(44)120)126-72(113)14-3-23(84)47(93)24(85)4-14)70-81(122)132-78(119)18-8-28(89)51(97)57(103)36(18)35-17(77(118)131-70)7-27(88)50(96)56(35)102/h1-10,31-32,43,66-70,81-111,122H,11-12H2 |
InChI Key | QROGXMPNPDWBEY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C81H54O51 |
Molecular Weight | 1843.30 g/mol |
Exact Mass | 1842.1631973 g/mol |
Topological Polar Surface Area (TPSA) | 890.00 Ų |
XlogP | 3.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.24% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.90% | 89.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.86% | 83.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.85% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.46% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.17% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.13% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.80% | 99.23% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.52% | 95.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.36% | 99.15% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 87.14% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.85% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 85.07% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 84.84% | 98.75% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.36% | 96.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.49% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.98% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.79% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.25% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.00% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Elaeagnus umbellata |
PubChem | 162956219 |
LOTUS | LTS0023769 |
wikiData | Q105226532 |