1,4,6-Trihydroxy-3-methoxy-8-methylxanthen-9-one
Internal ID | 72c58082-a328-4134-847c-b1adaa7ff9c7 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 1,4,6-trihydroxy-3-methoxy-8-methylxanthen-9-one |
SMILES (Canonical) | CC1=CC(=CC2=C1C(=O)C3=C(O2)C(=C(C=C3O)OC)O)O |
SMILES (Isomeric) | CC1=CC(=CC2=C1C(=O)C3=C(O2)C(=C(C=C3O)OC)O)O |
InChI | InChI=1S/C15H12O6/c1-6-3-7(16)4-9-11(6)14(19)12-8(17)5-10(20-2)13(18)15(12)21-9/h3-5,16-18H,1-2H3 |
InChI Key | GCSJYNGWIJNMRZ-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H12O6 |
Molecular Weight | 288.25 g/mol |
Exact Mass | 288.06338810 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of 1,4,6-Trihydroxy-3-methoxy-8-methylxanthen-9-one 2D Structure of 1,4,6-Trihydroxy-3-methoxy-8-methylxanthen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/146-trihydroxy-3-methoxy-8-methylxanthen-9-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.83% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.79% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 92.14% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.06% | 89.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 89.50% | 93.65% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.47% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.92% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.84% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.10% | 99.17% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.69% | 98.11% |
CHEMBL2581 | P07339 | Cathepsin D | 85.37% | 98.95% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 85.04% | 94.42% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.04% | 99.15% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 82.50% | 98.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.41% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.34% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Drimiopsis maculata |
PubChem | 86002886 |
LOTUS | LTS0078729 |
wikiData | Q105006441 |