14,15-dihydroxy-5Z,8Z,11Z-eicosatrienoic acid
| Internal ID | e4d83cfb-80b7-4207-ab5a-e67861d629f5 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Hydroxyeicosatrienoic acids |
| IUPAC Name | (5Z,8Z,11Z)-14,15-dihydroxyicosa-5,8,11-trienoic acid |
| SMILES (Canonical) | CCCCCC(C(CC=CCC=CCC=CCCCC(=O)O)O)O |
| SMILES (Isomeric) | CCCCCC(C(C/C=C\C/C=C\C/C=C\CCCC(=O)O)O)O |
| InChI | InChI=1S/C20H34O4/c1-2-3-12-15-18(21)19(22)16-13-10-8-6-4-5-7-9-11-14-17-20(23)24/h4,6-7,9-10,13,18-19,21-22H,2-3,5,8,11-12,14-17H2,1H3,(H,23,24)/b6-4-,9-7-,13-10- |
| InChI Key | SYAWGTIVOGUZMM-ILYOTBPNSA-N |
| Popularity | 54 references in papers |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24570956 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 4.30 |
| 14,15-DiHETrE |
| 14,15-dihydroxyeicosatrienoic Acid |
| 14,15-dihydroxy-5Z,8Z,11Z-eicosatrienoic acid |
| (+/-)14,15-DiHETrE |
| (5Z,8Z,11Z)-14,15-Dihydroxyicosa-5,8,11-trienoic acid |
| CHEBI:63966 |
| (5Z,8Z,11Z)-14,15-Dihydroxyeicosa-5,8,11-trienoic acid |
| (+/-)14,15-dihydroxy-5z,8z,11z-eicosatrienoic acid |
| 14,15-dihydroxyeicosa-5,8,11-trienoic acid |
| CHEMBL7514 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.96% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.36% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.02% | 96.09% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 94.83% | 85.94% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 90.91% | 97.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.90% | 93.56% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 88.06% | 92.08% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.27% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.09% | 97.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.17% | 90.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.80% | 100.00% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.47% | 96.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.07% | 89.63% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.26% | 93.31% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.10% | 96.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.08% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 5283147 |
| LOTUS | LTS0186562 |
| wikiData | Q27132938 |