1,4-Naphthalenedione, 2,3-dihydro-5-hydroxy-2-methyl-, (S)-
Internal ID | 25fb6c62-8d7f-477f-8155-dc63e4e017a9 |
Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
IUPAC Name | (2S)-5-hydroxy-2-methyl-2,3-dihydronaphthalene-1,4-dione |
SMILES (Canonical) | CC1CC(=O)C2=C(C1=O)C=CC=C2O |
SMILES (Isomeric) | C[C@H]1CC(=O)C2=C(C1=O)C=CC=C2O |
InChI | InChI=1S/C11H10O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-4,6,12H,5H2,1H3/t6-/m0/s1 |
InChI Key | ALPCEXCHMFUSAN-LURJTMIESA-N |
Popularity | 0 references in papers |
Molecular Formula | C11H10O3 |
Molecular Weight | 190.19 g/mol |
Exact Mass | 190.062994177 g/mol |
Topological Polar Surface Area (TPSA) | 54.40 Ų |
XlogP | 1.90 |
DTXSID501190348 |
76372-21-9 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.25% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.86% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.42% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.76% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.27% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.70% | 99.23% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.62% | 93.03% |
CHEMBL2535 | P11166 | Glucose transporter | 84.09% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.38% | 86.33% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.63% | 82.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.48% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.08% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.11% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juglans regia |
PubChem | 92449696 |
LOTUS | LTS0197701 |
wikiData | Q104914254 |