14-Methyloctadec-9-enoic acid
| Internal ID | a3198ae7-2c8b-4ca9-bada-0f48de49fee7 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | 14-methyloctadec-9-enoic acid |
| SMILES (Canonical) | CCCCC(C)CCCC=CCCCCCCCC(=O)O |
| SMILES (Isomeric) | CCCCC(C)CCCC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H36O2/c1-3-4-15-18(2)16-13-11-9-7-5-6-8-10-12-14-17-19(20)21/h7,9,18H,3-6,8,10-17H2,1-2H3,(H,20,21) |
| InChI Key | BPAJODDSPIIEIL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.271530387 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 7.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.96% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.64% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.17% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.77% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.73% | 93.56% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 89.99% | 97.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 89.73% | 93.31% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.58% | 97.29% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 88.86% | 92.26% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.36% | 96.47% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.51% | 100.00% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 86.57% | 85.94% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.36% | 92.08% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.87% | 89.34% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.37% | 96.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.79% | 100.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.86% | 89.63% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aristolochia grandiflora |
| PubChem | 53693726 |
| LOTUS | LTS0068562 |
| wikiData | Q104941192 |