14-Methoxy-8-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,10,15-hexaen-4-ol
| Internal ID | e54a55c9-1075-477d-b973-1da7d5ba15c0 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans |
| IUPAC Name | 14-methoxy-8-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,10,15-hexaen-4-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H15NO3/c1-19-14-5-3-10-12(14)7-17-16-11-6-9(18)2-4-15(11)20-8-13(10)16/h2,4,6-7,14,18H,3,5,8H2,1H3 |
| InChI Key | GGXULTHGGJJDGL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 51.60 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of 14-Methoxy-8-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,10,15-hexaen-4-ol](https://plantaedb.com/storage/docs/compounds/2023/11/14-methoxy-8-oxa-17-azatetracyclo87002701115heptadeca-11727351015-hexaen-4-ol.jpg "2D Structure of 14-Methoxy-8-oxa-17-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,10,15-hexaen-4-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.03% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.66% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.46% | 96.09% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 94.12% | 97.53% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.14% | 95.89% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 91.74% | 95.78% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 91.64% | 96.09% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 91.20% | 82.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.02% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.96% | 99.17% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.16% | 93.40% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.74% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.18% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.22% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.06% | 93.10% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.17% | 98.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.82% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.10% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.77% | 89.00% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.25% | 93.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.40% | 90.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.00% | 89.67% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.75% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.47% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.31% | 94.45% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.20% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163021806 |
| LOTUS | LTS0088398 |
| wikiData | Q104167156 |