14-Hydroxysparteine
| Internal ID | dca3f0ba-e219-4063-9bb4-7b4c08e76f15 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
| IUPAC Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol |
| SMILES (Canonical) | C1CCN2CC3CC(C2C1)CN4C3CCCC4O |
| SMILES (Isomeric) | C1CCN2CC3CC(C2C1)CN4C3CCCC4O |
| InChI | InChI=1S/C15H26N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h11-15,18H,1-10H2 |
| InChI Key | AFEKUFYCNWZEGZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.204513457 g/mol |
| Topological Polar Surface Area (TPSA) | 26.70 Ų |
| XlogP | 2.00 |
| AFEKUFYCNWZEGZ-UHFFFAOYSA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.85% | 97.25% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 88.90% | 95.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.67% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.68% | 97.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.60% | 95.50% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 86.57% | 96.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.99% | 95.89% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 85.90% | 83.57% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 85.64% | 91.76% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.52% | 95.58% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.13% | 94.78% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.49% | 93.04% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.22% | 98.33% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.31% | 93.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.59% | 92.94% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.36% | 98.46% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.33% | 93.03% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 80.11% | 97.98% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Genista majorica |
| Plagiocarpus axillaris |
| PubChem | 523576 |
| LOTUS | LTS0128153 |
| wikiData | Q104375884 |