(14-Ethoxy-5,9,14-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadec-11-enyl)methyl acetate
| Internal ID | c64e2d7e-ecc5-4a88-873e-466275b85219 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | (14-ethoxy-5,9,14-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadec-11-enyl)methyl acetate |
| SMILES (Canonical) | CCOC1(CC23CCC4C(CCCC4(C2C=CC1C3)C)(C)COC(=O)C)C |
| SMILES (Isomeric) | CCOC1(CC23CCC4C(CCCC4(C2C=CC1C3)C)(C)COC(=O)C)C |
| InChI | InChI=1S/C24H38O3/c1-6-27-23(5)15-24-13-10-19-21(3,16-26-17(2)25)11-7-12-22(19,4)20(24)9-8-18(23)14-24/h8-9,18-20H,6-7,10-16H2,1-5H3 |
| InChI Key | OWUYFGXZDKBJRR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.28209507 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.64% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.69% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.84% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.35% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.72% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.58% | 90.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.00% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.15% | 92.62% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 84.27% | 91.65% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.03% | 97.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.73% | 82.69% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.66% | 95.50% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 82.56% | 86.67% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.35% | 94.33% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.81% | 92.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.66% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.59% | 100.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.33% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sideritis soluta |
| PubChem | 162915244 |
| LOTUS | LTS0074271 |
| wikiData | Q105202311 |