1,4-Dimethyl-6-prop-1-en-2-ylbenzo[a]phenazine
| Internal ID | 49dab311-4040-4b56-a7b2-e581d01bc341 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | 1,4-dimethyl-6-prop-1-en-2-ylbenzo[a]phenazine |
| SMILES (Canonical) | CC1=C2C=C(C3=NC4=CC=CC=C4N=C3C2=C(C=C1)C)C(=C)C |
| SMILES (Isomeric) | CC1=C2C=C(C3=NC4=CC=CC=C4N=C3C2=C(C=C1)C)C(=C)C |
| InChI | InChI=1S/C21H18N2/c1-12(2)15-11-16-13(3)9-10-14(4)19(16)21-20(15)22-17-7-5-6-8-18(17)23-21/h5-11H,1H2,2-4H3 |
| InChI Key | QWQGDUNJMXPOLV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H18N2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.146998583 g/mol |
| Topological Polar Surface Area (TPSA) | 25.80 Ų |
| XlogP | 6.00 |
| There are no found synonyms. |
![2D Structure of 1,4-Dimethyl-6-prop-1-en-2-ylbenzo[a]phenazine](https://plantaedb.com/storage/docs/compounds/2023/11/14-dimethyl-6-prop-1-en-2-ylbenzoaphenazine.jpg "2D Structure of 1,4-Dimethyl-6-prop-1-en-2-ylbenzo[a]phenazine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.22% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.05% | 91.49% |
| CHEMBL240 | Q12809 | HERG | 93.29% | 89.76% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.58% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.86% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.79% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.48% | 98.95% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.68% | 93.65% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.34% | 95.56% |
| CHEMBL1936 | P10721 | Stem cell growth factor receptor | 84.73% | 84.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.68% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.49% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.71% | 96.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.43% | 83.82% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.23% | 97.36% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.22% | 96.25% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.89% | 96.47% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.04% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Emmotum nitens |
| PubChem | 162820587 |
| LOTUS | LTS0047890 |
| wikiData | Q105229335 |