1,4-Anthracenedione, 5,6,7,8-tetrahydro-2-hydroxy-3-[(1R)-2-hydroxy-1-methylethyl]-5,5,9-trimethyl-
Internal ID | 018944c4-d7fe-4c77-8375-74f63f0f80bd |
Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
IUPAC Name | 4-hydroxy-3-[(2R)-1-hydroxypropan-2-yl]-5,5,9-trimethyl-7,8-dihydro-6H-anthracene-1,2-dione |
SMILES (Canonical) | CC1=C2C(=CC3=C1CCCC3(C)C)C(=C(C(=O)C2=O)C(C)CO)O |
SMILES (Isomeric) | CC1=C2C(=CC3=C1CCCC3(C)C)C(=C(C(=O)C2=O)[C@@H](C)CO)O |
InChI | InChI=1S/C20H24O4/c1-10(9-21)15-17(22)13-8-14-12(6-5-7-20(14,3)4)11(2)16(13)19(24)18(15)23/h8,10,21-22H,5-7,9H2,1-4H3/t10-/m0/s1 |
InChI Key | HPDJDMAPXQNONF-JTQLQIEISA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O4 |
Molecular Weight | 328.40 g/mol |
Exact Mass | 328.16745924 g/mol |
Topological Polar Surface Area (TPSA) | 74.60 Ų |
XlogP | 3.40 |
CHEMBL1993232 |
NSC-686516 |
NCI60_031206 |
1,4-Anthracenedione, 5,6,7,8-tetrahydro-2-hydroxy-3-[(1R)-2-hydroxy-1-methylethyl]-5,5,9-trimethyl- |
3-hydroxy-2-[(1R)-2-hydroxy-1-methyl-ethyl]-8,8,10-trimethyl-6,7-dihydro-5H-anthracene-1,4-dione |
![2D Structure of 1,4-Anthracenedione, 5,6,7,8-tetrahydro-2-hydroxy-3-[(1R)-2-hydroxy-1-methylethyl]-5,5,9-trimethyl- 2D Structure of 1,4-Anthracenedione, 5,6,7,8-tetrahydro-2-hydroxy-3-[(1R)-2-hydroxy-1-methylethyl]-5,5,9-trimethyl-](https://plantaedb.com/storage/docs/compounds/2023/11/14-anthracenedione-5678-tetrahydro-2-hydroxy-3-1r-2-hydroxy-1-methylethyl-559-trimethyl-.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.33% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.72% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.24% | 95.56% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.00% | 96.38% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.79% | 94.75% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.12% | 91.79% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.42% | 93.40% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.28% | 98.75% |
CHEMBL2535 | P11166 | Glucose transporter | 87.89% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.10% | 89.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 86.82% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.62% | 90.71% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 85.17% | 95.34% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.18% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.30% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.05% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.52% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.01% | 100.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.51% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia aegyptiaca |
PubChem | 389887 |
LOTUS | LTS0212857 |
wikiData | Q105031652 |