(13E)-15-Acetoxylabda-8,13-dien-19-oic acid
Internal ID | aa69ebd9-bbce-47ed-87f1-206f242ac2e1 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (1S,4aS,8aR)-5-[(E)-5-acetyloxy-3-methylpent-3-enyl]-1,4a,6-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-1-carboxylic acid |
SMILES (Canonical) | CC1=C(C2(CCCC(C2CC1)(C)C(=O)O)C)CCC(=CCOC(=O)C)C |
SMILES (Isomeric) | CC1=C([C@]2(CCC[C@]([C@@H]2CC1)(C)C(=O)O)C)CC/C(=C/COC(=O)C)/C |
InChI | InChI=1S/C22H34O4/c1-15(11-14-26-17(3)23)7-9-18-16(2)8-10-19-21(18,4)12-6-13-22(19,5)20(24)25/h11,19H,6-10,12-14H2,1-5H3,(H,24,25)/b15-11+/t19-,21-,22+/m1/s1 |
InChI Key | VYHQRVHVJIOYAH-SIXDBYLKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H34O4 |
Molecular Weight | 362.50 g/mol |
Exact Mass | 362.24570956 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 4.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.70% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.04% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.80% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.73% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.89% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.55% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.14% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.66% | 95.50% |
CHEMBL233 | P35372 | Mu opioid receptor | 84.59% | 97.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.90% | 95.56% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.91% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.56% | 86.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.68% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.38% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.41% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.01% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 101675266 |
NPASS | NPC116112 |
LOTUS | LTS0078843 |
wikiData | Q105298996 |