[1,3]Dioxolo[4,5-j]phenanthridin-3-ol
| Internal ID | d4ff122e-e161-4699-8b81-93664cead370 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Phenanthridines and derivatives |
| IUPAC Name | [1,3]dioxolo[4,5-j]phenanthridin-3-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H9NO3/c16-9-1-2-10-11-5-14-13(17-7-18-14)3-8(11)6-15-12(10)4-9/h1-6,16H,7H2 |
| InChI Key | YTVBGVCSVJGIBN-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.058243149 g/mol |
| Topological Polar Surface Area (TPSA) | 51.60 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of [1,3]Dioxolo[4,5-j]phenanthridin-3-ol](https://plantaedb.com/storage/docs/compounds/2023/11/13dioxolo45-jphenanthridin-3-ol.jpg "2D Structure of [1,3]Dioxolo[4,5-j]phenanthridin-3-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.16% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.04% | 91.49% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.69% | 93.10% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.69% | 83.57% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 87.66% | 93.24% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 87.54% | 92.51% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.34% | 99.15% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.04% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.99% | 94.45% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 86.83% | 89.44% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.50% | 85.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.79% | 86.33% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.55% | 94.80% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.52% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.12% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.09% | 94.00% |
| CHEMBL3984 | Q99640 | Tyrosine- and threonine-specific cdc2-inhibitory kinase | 84.99% | 85.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.67% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.80% | 94.73% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.57% | 92.62% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.26% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Crinum firmifolium |
| PubChem | 136694446 |
| LOTUS | LTS0206167 |
| wikiData | Q105362286 |