(1S,3S,6R,8S,11R,12S,15R,16S,19R,21R,23R)-3,7,7,11,16,20,20-heptamethyl-24-oxahexacyclo[13.9.0.01,23.03,12.06,11.016,21]tetracosane-8,19-diol
| Internal ID | add853b2-14e4-4b7c-a53f-6c98028d8c6c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (1S,3S,6R,8S,11R,12S,15R,16S,19R,21R,23R)-3,7,7,11,16,20,20-heptamethyl-24-oxahexacyclo[13.9.0.01,23.03,12.06,11.016,21]tetracosane-8,19-diol |
| SMILES (Canonical) | CC1(C2CCC3(CC45C(CCC3C2(CCC1O)C)C6(CCC(C(C6CC4O5)(C)C)O)C)C)C |
| SMILES (Isomeric) | C[C@@]12CC[C@@H]3[C@@]([C@H]1CC[C@@H]4[C@]5(CC[C@H](C([C@@H]5C[C@@H]6[C@@]4(C2)O6)(C)C)O)C)(CC[C@@H](C3(C)C)O)C |
| InChI | InChI=1S/C30H50O3/c1-25(2)18-10-13-27(5)17-30-20(9-8-19(27)28(18,6)14-11-22(25)31)29(7)15-12-23(32)26(3,4)21(29)16-24(30)33-30/h18-24,31-32H,8-17H2,1-7H3/t18-,19-,20+,21-,22-,23+,24+,27-,28-,29+,30-/m0/s1 |
| InChI Key | KBPDQXXAYOMILW-SIRIYIFESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.70 g/mol |
| Exact Mass | 458.37599545 g/mol |
| Topological Polar Surface Area (TPSA) | 53.00 Ų |
| XlogP | 6.90 |
| There are no found synonyms. |
![2D Structure of (1S,3S,6R,8S,11R,12S,15R,16S,19R,21R,23R)-3,7,7,11,16,20,20-heptamethyl-24-oxahexacyclo[13.9.0.01,23.03,12.06,11.016,21]tetracosane-8,19-diol](https://plantaedb.com/storage/docs/compounds/2023/11/13dc0570-8563-11ee-a132-759ca07923ff.jpg "2D Structure of (1S,3S,6R,8S,11R,12S,15R,16S,19R,21R,23R)-3,7,7,11,16,20,20-heptamethyl-24-oxahexacyclo[13.9.0.01,23.03,12.06,11.016,21]tetracosane-8,19-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.40% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.73% | 97.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.83% | 90.17% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.82% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.54% | 96.09% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 88.53% | 98.10% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.43% | 95.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.01% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.83% | 91.11% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.76% | 95.58% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.12% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.16% | 95.38% |
| CHEMBL2431 | P31751 | Serine/threonine-protein kinase AKT2 | 81.05% | 98.33% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.32% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Huperzia serrata |
| PubChem | 162937341 |
| LOTUS | LTS0087721 |
| wikiData | Q105138414 |