(6S,6aS,10aS)-4,6-dihydroxy-7,7,10a-trimethyl-3-propan-2-yl-6a,8,9,10-tetrahydro-6H-benzo[c]chromene-1-carbaldehyde
Internal ID | 10290e1b-fcaf-454e-8362-7d4ad27c0fc1 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans |
IUPAC Name | (6S,6aS,10aS)-4,6-dihydroxy-7,7,10a-trimethyl-3-propan-2-yl-6a,8,9,10-tetrahydro-6H-benzo[c]chromene-1-carbaldehyde |
SMILES (Canonical) | CC(C)C1=C(C2=C(C(=C1)C=O)C3(CCCC(C3C(O2)O)(C)C)C)O |
SMILES (Isomeric) | CC(C)C1=C(C2=C(C(=C1)C=O)[C@]3(CCCC([C@@H]3[C@H](O2)O)(C)C)C)O |
InChI | InChI=1S/C20H28O4/c1-11(2)13-9-12(10-21)14-16(15(13)22)24-18(23)17-19(3,4)7-6-8-20(14,17)5/h9-11,17-18,22-23H,6-8H2,1-5H3/t17-,18-,20+/m0/s1 |
InChI Key | WICUQKGNEKIQJS-CMKODMSKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O4 |
Molecular Weight | 332.40 g/mol |
Exact Mass | 332.19875937 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 4.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.32% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.19% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.70% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.23% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.79% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.97% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.05% | 94.73% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 89.68% | 98.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.43% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.65% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.09% | 93.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.05% | 96.77% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.22% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.19% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.81% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.40% | 86.33% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.41% | 99.18% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.28% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Plectranthus barbatus |
Salvia munzii |
PubChem | 163018219 |
LOTUS | LTS0185033 |
wikiData | Q105306148 |