(13aR)-2,3-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-9,10-diol
| Internal ID | 3cf77b83-10be-4187-a8a6-6a036366e59d |
| Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
| IUPAC Name | (13aR)-2,3-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-9,10-diol |
| SMILES (Canonical) | COC1=C(C=C2C3CC4=C(CN3CCC2=C1)C(=C(C=C4)O)O)OC |
| SMILES (Isomeric) | COC1=C(C=C2[C@H]3CC4=C(CN3CCC2=C1)C(=C(C=C4)O)O)OC |
| InChI | InChI=1S/C19H21NO4/c1-23-17-8-12-5-6-20-10-14-11(3-4-16(21)19(14)22)7-15(20)13(12)9-18(17)24-2/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m1/s1 |
| InChI Key | SUHDGQSJNMIRRN-OAHLLOKOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 62.20 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of (13aR)-2,3-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-9,10-diol](https://plantaedb.com/storage/docs/compounds/2023/11/13ar-23-dimethoxy-681313a-tetrahydro-5h-isoquinolino21-bisoquinoline-910-diol.jpg "2D Structure of (13aR)-2,3-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-9,10-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.27% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.54% | 91.11% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 96.60% | 91.79% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 96.34% | 95.62% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.41% | 92.94% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.00% | 85.14% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 91.35% | 91.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.23% | 86.33% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.98% | 93.40% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.54% | 89.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.14% | 95.89% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.36% | 88.48% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.33% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.92% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.49% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.34% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.80% | 93.99% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.04% | 91.03% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.50% | 90.71% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 84.41% | 95.12% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.92% | 90.00% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 82.50% | 95.70% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.94% | 100.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.19% | 82.38% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.65% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.17% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Corydalis taliensis |
| PubChem | 101663206 |
| LOTUS | LTS0152174 |
| wikiData | Q105260938 |