N-[1-[[1-[[1-[[1-[[1-[[1-[[1-[[1-[[1-[[3-[[1-[[1-[[1-[[1-[[1-[[9-(2-aminoethyl)-3-butan-2-yl-6-(hydroxymethyl)-12,16-dimethyl-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]amino]-1-oxobut-2-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-oxoprop-1-en-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1-oxobut-2-en-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]-1-[2-(3-hydroxydodecanoylamino)but-2-enoyl]pyrrolidine-2-carboxamide
| Internal ID | eeb1eb31-66fc-4346-b87f-2b2eed85d4b5 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | N-[1-[[1-[[1-[[1-[[1-[[1-[[1-[[1-[[1-[[3-[[1-[[1-[[1-[[1-[[1-[[9-(2-aminoethyl)-3-butan-2-yl-6-(hydroxymethyl)-12,16-dimethyl-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]amino]-1-oxobut-2-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-oxoprop-1-en-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1-oxobut-2-en-2-yl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]-1-[2-(3-hydroxydodecanoylamino)but-2-enoyl]pyrrolidine-2-carboxamide |
| SMILES (Canonical) | CCCCCCCCCC(CC(=O)NC(=CC)C(=O)N1CCCC1C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C(C)C)C(=O)NC(C)C(=O)NC(=CC)C(=O)NC(CO)C(=O)NC(C(C)C)C(=O)NC(C(C)CC)C(=O)NC(=C)C(=O)NC(C)C(=O)NC(C(C)C)C(=O)NC(C)C(=O)NC(C(C)C)C(=O)NC(=CC)C(=O)NC2C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC2=O)C)CCN)CO)C(C)CC)C)O |
| SMILES (Isomeric) | CCCCCCCCCC(CC(=O)NC(=CC)C(=O)N1CCCC1C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C(C)C)C(=O)NC(C)C(=O)NC(=CC)C(=O)NC(CO)C(=O)NC(C(C)C)C(=O)NC(C(C)CC)C(=O)NC(=C)C(=O)NC(C)C(=O)NC(C(C)C)C(=O)NC(C)C(=O)NC(C(C)C)C(=O)NC(=CC)C(=O)NC2C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC2=O)C)CCN)CO)C(C)CC)C)O |
| InChI | InChI=1S/C99H165N23O27/c1-26-32-33-34-35-36-37-39-62(125)44-70(126)109-65(31-6)98(147)122-43-38-40-69(122)91(140)104-54(18)79(128)101-53(17)78(127)102-58(22)83(132)115-71(47(7)8)92(141)105-56(20)81(130)110-63(29-4)86(135)113-67(45-123)89(138)118-74(50(13)14)95(144)119-75(51(15)27-2)96(145)107-55(19)80(129)103-59(23)84(133)116-72(48(9)10)93(142)106-60(24)85(134)117-73(49(11)12)94(143)111-64(30-5)87(136)121-77-61(25)149-99(148)76(52(16)28-3)120-90(139)68(46-124)114-88(137)66(41-42-100)112-82(131)57(21)108-97(77)146/h29-31,47-54,56-62,66-69,71-77,123-125H,19,26-28,32-46,100H2,1-18,20-25H3,(H,101,128)(H,102,127)(H,103,129)(H,104,140)(H,105,141)(H,106,142)(H,107,145)(H,108,146)(H,109,126)(H,110,130)(H,111,143)(H,112,131)(H,113,135)(H,114,137)(H,115,132)(H,116,133)(H,117,134)(H,118,138)(H,119,144)(H,120,139)(H,121,136) |
| InChI Key | NVSQQGJQHRAZND-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C99H165N23O27 |
| Molecular Weight | 2109.50 g/mol |
| Exact Mass | 2109.2278819 g/mol |
| Topological Polar Surface Area (TPSA) | 744.00 Ų |
| XlogP | 4.10 |
| Atomic LogP (AlogP) | -4.07 |
| H-Bond Acceptor | 28 |
| H-Bond Donor | 25 |
| Rotatable Bonds | 56 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5904 | 59.04% |
| Caco-2 | - | 0.8592 | 85.92% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Lysosomes | 0.5574 | 55.74% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8079 | 80.79% |
| OATP1B3 inhibitior | + | 0.9112 | 91.12% |
| MATE1 inhibitior | - | 0.9412 | 94.12% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9759 | 97.59% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8721 | 87.21% |
| CYP3A4 substrate | + | 0.7508 | 75.08% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8463 | 84.63% |
| CYP3A4 inhibition | - | 0.7533 | 75.33% |
| CYP2C9 inhibition | - | 0.8683 | 86.83% |
| CYP2C19 inhibition | - | 0.8647 | 86.47% |
| CYP2D6 inhibition | - | 0.9116 | 91.16% |
| CYP1A2 inhibition | - | 0.8823 | 88.23% |
| CYP2C8 inhibition | + | 0.8133 | 81.33% |
| CYP inhibitory promiscuity | - | 0.9736 | 97.36% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.5183 | 51.83% |
| Eye corrosion | - | 0.9826 | 98.26% |
| Eye irritation | - | 0.8955 | 89.55% |
| Skin irritation | - | 0.7575 | 75.75% |
| Skin corrosion | - | 0.9045 | 90.45% |
| Ames mutagenesis | - | 0.6100 | 61.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7178 | 71.78% |
| Micronuclear | + | 0.8200 | 82.00% |
| Hepatotoxicity | + | 0.5713 | 57.13% |
| skin sensitisation | - | 0.8470 | 84.70% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.7889 | 78.89% |
| Mitochondrial toxicity | + | 0.8125 | 81.25% |
| Nephrotoxicity | + | 0.9110 | 91.10% |
| Acute Oral Toxicity (c) | III | 0.6095 | 60.95% |
| Estrogen receptor binding | + | 0.5610 | 56.10% |
| Androgen receptor binding | + | 0.7587 | 75.87% |
| Thyroid receptor binding | + | 0.7484 | 74.84% |
| Glucocorticoid receptor binding | + | 0.7956 | 79.56% |
| Aromatase binding | + | 0.7957 | 79.57% |
| PPAR gamma | + | 0.7803 | 78.03% |
| Honey bee toxicity | - | 0.6642 | 66.42% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | + | 0.5904 | 59.04% |
| Fish aquatic toxicity | + | 0.9057 | 90.57% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.74% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.73% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.35% | 96.61% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 99.23% | 94.66% |
| CHEMBL4801 | P29466 | Caspase-1 | 99.00% | 96.85% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 98.09% | 92.38% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.06% | 98.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 97.94% | 96.47% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.30% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.27% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.58% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.32% | 99.17% |
| CHEMBL4072 | P07858 | Cathepsin B | 95.87% | 93.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.78% | 91.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.62% | 93.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.99% | 97.25% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 94.58% | 92.12% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.24% | 97.29% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 94.14% | 94.80% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.91% | 97.64% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 93.71% | 96.11% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 93.70% | 97.47% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.26% | 90.08% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 93.05% | 92.88% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.89% | 90.71% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 92.70% | 96.31% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 92.56% | 93.18% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.55% | 91.19% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.34% | 95.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 92.04% | 100.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.95% | 97.23% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 91.70% | 92.86% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.15% | 96.90% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 91.05% | 95.92% |
| CHEMBL3468 | P55210 | Caspase-7 | 90.73% | 95.68% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.73% | 100.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.63% | 95.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.61% | 95.56% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 90.51% | 94.50% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.44% | 95.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.43% | 97.14% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 90.01% | 88.42% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.95% | 93.03% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 89.42% | 82.38% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.21% | 100.00% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 88.63% | 95.20% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 88.33% | 90.24% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 88.32% | 98.75% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 88.04% | 98.10% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 87.48% | 93.10% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 87.24% | 95.52% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.97% | 94.33% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 86.69% | 91.81% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.49% | 93.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 86.22% | 92.32% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 86.00% | 97.29% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 85.84% | 97.50% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 85.76% | 96.33% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 85.75% | 98.05% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 84.66% | 96.67% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 83.37% | 95.27% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 83.20% | 97.56% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.91% | 99.18% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.88% | 88.56% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 81.75% | 98.24% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.70% | 91.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.60% | 99.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.47% | 95.89% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.22% | 91.24% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.93% | 89.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.47% | 100.00% |
| CHEMBL4374 | Q9Y5X4 | Photoreceptor-specific nuclear receptor | 80.18% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163059867 |
| LOTUS | LTS0217722 |
| wikiData | Q104180066 |