1,3,8-trihydroxy-6-[(2S)-2-hydroxypropyl]anthracene-9,10-dione
| Internal ID | b97999a4-a0fe-4751-901a-3c5c7695fdb9 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | 1,3,8-trihydroxy-6-[(2S)-2-hydroxypropyl]anthracene-9,10-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H14O6/c1-7(18)2-8-3-10-14(12(20)4-8)17(23)15-11(16(10)22)5-9(19)6-13(15)21/h3-7,18-21H,2H2,1H3/t7-/m0/s1 |
| InChI Key | LCYTUQNPPBLNJZ-ZETCQYMHSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 115.00 Ų |
| XlogP | 2.40 |
| SCHEMBL20515152 |
| BDBM50020377 |
| 1,3,8-trihydroxy-6-[(2S)-2-hydroxypropyl]anthracene-9,10-dione |
![2D Structure of 1,3,8-trihydroxy-6-[(2S)-2-hydroxypropyl]anthracene-9,10-dione](https://plantaedb.com/storage/docs/compounds/2023/11/138-trihydroxy-6-2s-2-hydroxypropylanthracene-910-dione.jpg "2D Structure of 1,3,8-trihydroxy-6-[(2S)-2-hydroxypropyl]anthracene-9,10-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.20% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.53% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.77% | 90.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.07% | 96.38% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.53% | 99.15% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.37% | 96.12% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.97% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.48% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.40% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.69% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.17% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.19% | 85.14% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.70% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.55% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.78% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 51537215 |
| LOTUS | LTS0079642 |
| wikiData | Q105150066 |