1,3,7-Nonatriene, 4,8-dimethyl-
| Internal ID | 07b16475-89f3-402e-8f5d-78eb28db882e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Acyclic monoterpenoids |
| IUPAC Name | 4,8-dimethylnona-1,3,7-triene |
| SMILES (Canonical) | CC(=CCCC(=CC=C)C)C |
| SMILES (Isomeric) | CC(=CCCC(=CC=C)C)C |
| InChI | InChI=1S/C11H18/c1-5-7-11(4)9-6-8-10(2)3/h5,7-8H,1,6,9H2,2-4H3 |
| InChI Key | LUKZREJJLWEWQM-UHFFFAOYSA-N |
| Popularity | 101 references in papers |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.140850574 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.60 |
| 4,8-Dimethylnona-1,3,7-triene |
| 4,8-Dimethyl-1,3,7-nonatriene |
| C11H18 |
| EINECS 257-509-8 |
| FT-0652389 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.60% | 91.11% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.37% | 92.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.47% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.40% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.63% | 94.73% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.68% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Reynoutria sachalinensis |
| PubChem | 103555 |
| LOTUS | LTS0224683 |
| wikiData | Q81995450 |