(1S,2S,20S,42S,46S)-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-pentadecahydroxy-15-[(1S,2S,20S,46R)-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-pentadecahydroxy-4,17,22,40,44-pentaoxo-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaen-46-yl]-46-[(3R,4R,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11(16),12,14,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone
Internal ID | 079472df-84f9-4f4a-9fd5-151f4f34fe3e |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (1S,2S,20S,42S,46S)-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-pentadecahydroxy-15-[(1S,2S,20S,46R)-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-pentadecahydroxy-4,17,22,40,44-pentaoxo-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaen-46-yl]-46-[(3R,4R,5S)-2,3,4,5-tetrahydroxyoxan-2-yl]-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11(16),12,14,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone |
SMILES (Canonical) | C1C(C(C(C(O1)(C2C3C4C5C(COC(=O)C6=C(C7=C(C(=C(C=C7C(=O)O5)O)O)O)C(=C(C(=C6C8C9C1C5C(COC(=O)C6=CC(=C(C(=C6C6=C(C(=C(C=C6C(=O)O5)O)O)O)O)O)O)OC(=O)C5=CC(=C(C(=C5C5=C(C(=C(C(=C5O)O)O)C5=C(C8=C(C(=C5O)O)O)C(=O)O9)C(=O)O1)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1C1=C(C(=C(C(=C1O)O)O)C1=C(C2=C(C(=C1O)O)O)C(=O)O3)C(=O)O4)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H]([C@H](C(O1)([C@@H]2[C@H]3[C@H]4[C@@H]5[C@H](COC(=O)C6=C(C7=C(C(=C(C=C7C(=O)O5)O)O)O)C(=C(C(=C6[C@H]8C9[C@H]1[C@@H]5[C@H](COC(=O)C6=CC(=C(C(=C6C6=C(C(=C(C=C6C(=O)O5)O)O)O)O)O)O)OC(=O)C5=CC(=C(C(=C5C5=C(C(=C(C(=C5O)O)O)C5=C(C8=C(C(=C5O)O)O)C(=O)O9)C(=O)O1)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1C1=C(C(=C(C(=C1O)O)O)C1=C(C2=C(C(=C1O)O)O)C(=O)O3)C(=O)O4)O)O)O)O)O)O)O |
InChI | InChI=1S/C87H58O55/c88-14-1-9-22(50(100)44(14)94)23-10(2-15(89)45(95)51(23)101)80(124)137-70-20(7-132-77(9)121)135-78(122)11-3-16(90)46(96)52(102)24(11)28-38-30(58(108)65(115)56(28)106)31-40-35(63(113)68(118)59(31)109)36(72(139-83(40)127)74(70)141-84(38)128)34-37-27(55(105)67(117)62(34)112)26-13(5-18(92)48(98)54(26)104)81(125)138-71-21(8-133-82(37)126)136-79(123)12-4-17(91)47(97)53(103)25(12)29-39-32(60(110)66(116)57(29)107)33-41-42(64(114)69(119)61(33)111)43(73(140-86(41)130)75(71)142-85(39)129)87(131)76(120)49(99)19(93)6-134-87/h1-5,19-21,36,43,49,70-76,88-120,131H,6-8H2/t19-,20-,21-,36+,43-,49+,70-,71-,72?,73-,74+,75+,76+,87?/m0/s1 |
InChI Key | KKULBJBRQDSWRB-JXOWBFLGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C87H58O55 |
Molecular Weight | 1983.40 g/mol |
Exact Mass | 1982.1741559 g/mol |
Topological Polar Surface Area (TPSA) | 960.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.50% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.46% | 85.14% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.38% | 96.38% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.60% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 91.17% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.08% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.43% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.20% | 99.15% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.89% | 93.03% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.73% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.57% | 95.89% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 87.49% | 96.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.67% | 99.23% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 83.40% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.96% | 98.75% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.85% | 82.69% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.77% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.89% | 93.40% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.15% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Quercus petraea |
Quercus robur |
PubChem | 101670611 |
LOTUS | LTS0212212 |
wikiData | Q104392118 |