(2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-6-[(1S,2S,3'S,4S,5'R,6R,6'R,7S,8R,9S,12S,13R,16S)-3',6'-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-4-hydroxy-2-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 597c0d97-3842-46b2-810e-d802b02172f0 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-6-[(1S,2S,3'S,4S,5'R,6R,6'R,7S,8R,9S,12S,13R,16S)-3',6'-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-4-hydroxy-2-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1O)O |
SMILES (Isomeric) | C[C@@H]1C[C@@H]([C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)C)O[C@H]1O)O |
InChI | InChI=1S/C45H72O18/c1-17-13-28(47)45(63-39(17)55)18(2)29-26(62-45)15-25-23-8-7-21-14-22(9-11-43(21,5)24(23)10-12-44(25,29)6)58-42-38(61-41-35(53)33(51)31(49)20(4)57-41)36(54)37(27(16-46)59-42)60-40-34(52)32(50)30(48)19(3)56-40/h7,17-20,22-42,46-55H,8-16H2,1-6H3/t17-,18+,19+,20+,22+,23-,24+,25+,26+,27-,28+,29+,30+,31+,32-,33-,34-,35-,36+,37-,38-,39-,40+,41+,42-,43+,44+,45-/m1/s1 |
InChI Key | SCEKBVUERPJRNS-GDVAPLMRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H72O18 |
Molecular Weight | 901.00 g/mol |
Exact Mass | 900.47186544 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | -0.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.73% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.60% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.02% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.86% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.15% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.16% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.84% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.71% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.32% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.15% | 94.75% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 87.61% | 95.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.52% | 89.05% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.08% | 96.43% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.78% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.28% | 96.61% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 82.55% | 94.50% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.41% | 97.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.75% | 97.36% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.67% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.65% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.59% | 92.94% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.03% | 97.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.64% | 92.50% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.43% | 86.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.01% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum lasiocarpum |
PubChem | 101838956 |
LOTUS | LTS0158876 |
wikiData | Q105250060 |