(1S,4aS,7S,7aR)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbaldehyde
Internal ID | b0efc550-0abf-4fd2-81eb-f0987afc71fe |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | (1S,4aS,7S,7aR)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbaldehyde |
SMILES (Canonical) | CC1(CCC2C1C(OC=C2C=O)OC3C(C(C(C(O3)CO)O)O)O)O |
SMILES (Isomeric) | C[C@@]1(CC[C@H]2[C@H]1[C@@H](OC=C2C=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O |
InChI | InChI=1S/C16H24O9/c1-16(22)3-2-8-7(4-17)6-23-14(10(8)16)25-15-13(21)12(20)11(19)9(5-18)24-15/h4,6,8-15,18-22H,2-3,5H2,1H3/t8-,9-,10+,11-,12+,13-,14+,15+,16+/m1/s1 |
InChI Key | XQUFDDXBHJINGZ-YOPUQRQPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H24O9 |
Molecular Weight | 360.36 g/mol |
Exact Mass | 360.14203234 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
![2D Structure of (1S,4aS,7S,7aR)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbaldehyde 2D Structure of (1S,4aS,7S,7aR)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/1311da70-857d-11ee-b1a2-cb0ed2a6db90.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.63% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.61% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.92% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.73% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.24% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.48% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.35% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.54% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.52% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.83% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 84.57% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.73% | 86.92% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.34% | 96.61% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.56% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.65% | 89.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.00% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pedicularis palustris |
PubChem | 163028016 |
LOTUS | LTS0266970 |
wikiData | Q105340048 |