13-Hpode
| Internal ID | ca4625fd-3f22-44c9-8569-eff6551a605b |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Lineolic acids and derivatives |
| IUPAC Name | (9Z,11E)-13-hydroperoxyoctadeca-9,11-dienoic acid |
| SMILES (Canonical) | CCCCCC(C=CC=CCCCCCCCC(=O)O)OO |
| SMILES (Isomeric) | CCCCCC(/C=C/C=C\CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H32O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h7,9,12,15,17,21H,2-6,8,10-11,13-14,16H2,1H3,(H,19,20)/b9-7-,15-12+ |
| InChI Key | JDSRHVWSAMTSSN-BSZOFBHHSA-N |
| Popularity | 179 references in papers |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.23005950 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 5.40 |
| 13-Hpode |
| 13-Hpod |
| (+/-)13-HpODE |
| (9Z,11E)-13-hydroperoxyoctadeca-9,11-dienoic acid |
| Linoleic acid 13-hydroperoxide |
| DPF3WUY4S4 |
| ( inverted exclamation markA)13-HpODE |
| 13-hydroperoxy-9-cis-11-trans-octadecadienoic acid |
| 13-Hydroperoxyoctadeca-cis-9,trans-11-dienoic acid |
| 9,11-Octadecadienoic acid, 13-hydroperoxy-, (9Z,11E)- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.82% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.29% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.37% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.33% | 92.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.94% | 93.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.03% | 89.63% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.25% | 97.29% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 88.64% | 97.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.34% | 90.17% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 88.23% | 96.00% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 88.21% | 92.26% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 87.85% | 85.94% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.44% | 91.81% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.01% | 96.95% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.28% | 100.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.20% | 92.32% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.11% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.39% | 91.11% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.32% | 96.47% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.21% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.19% | 96.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.39% | 99.35% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.05% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Oryza sativa |
| PubChem | 6437847 |
| LOTUS | LTS0212632 |
| wikiData | Q27163178 |