1,3-Dimethoxy-5-(2-phenylethenyl)benzene
| Internal ID | 55cc60e9-5d42-4e1c-a0da-35908a44e6b6 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 1,3-dimethoxy-5-(2-phenylethenyl)benzene |
| SMILES (Canonical) | COC1=CC(=CC(=C1)C=CC2=CC=CC=C2)OC |
| SMILES (Isomeric) | COC1=CC(=CC(=C1)C=CC2=CC=CC=C2)OC |
| InChI | InChI=1S/C16H16O2/c1-17-15-10-14(11-16(12-15)18-2)9-8-13-6-4-3-5-7-13/h3-12H,1-2H3 |
| InChI Key | BIYGTLDPTJMNET-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.115029749 g/mol |
| Topological Polar Surface Area (TPSA) | 18.50 Ų |
| XlogP | 4.10 |
| Benzene, 1,3-dimethoxy-5-(2-phenylethenyl)- |
| BIYGTLDPTJMNET-UHFFFAOYSA-N |
| DTXSID201032440 |
| BCP18619 |
| AKOS028109867 |
| FT-0641701 |
| FT-0660020 |
| A839529 |
| Trans-3,5-Dimethoxystilbene;trans-Pinosylvin dimethyl ether |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.19% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.17% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.76% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.47% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.41% | 93.99% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 89.25% | 94.08% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.34% | 94.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.79% | 94.73% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 82.43% | 92.86% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.98% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.47% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alnus maximowiczii |
| Lonchocarpus chiricanus |
| Osteospermum ilicifolium |
| Pinus albicaulis |
| Pinus brutia var. pityusa |
| Pinus parviflora |
| Pinus sibirica |
| PubChem | 238778 |
| LOTUS | LTS0130313 |
| wikiData | Q104936881 |