1,3-Dihydroxy-5,6-dimethoxy-10-methylacridin-9-one
| Internal ID | 90137860-0e84-47b3-830f-756fae985eb7 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1,3-dihydroxy-5,6-dimethoxy-10-methylacridin-9-one |
| SMILES (Canonical) | CN1C2=C(C(=CC(=C2)O)O)C(=O)C3=C1C(=C(C=C3)OC)OC |
| SMILES (Isomeric) | CN1C2=C(C(=CC(=C2)O)O)C(=O)C3=C1C(=C(C=C3)OC)OC |
| InChI | InChI=1S/C16H15NO5/c1-17-10-6-8(18)7-11(19)13(10)15(20)9-4-5-12(21-2)16(22-3)14(9)17/h4-7,18-19H,1-3H3 |
| InChI Key | RPXHTTDVHFFAHL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09502258 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.53% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.14% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.08% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.96% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.57% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.45% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.41% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.07% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.83% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.69% | 98.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.54% | 89.62% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.30% | 94.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.16% | 90.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.20% | 96.12% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.48% | 93.65% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 85.48% | 94.42% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 85.37% | 80.78% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.27% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.93% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.90% | 99.15% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.48% | 90.20% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.29% | 92.68% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus maxima |
| PubChem | 13965867 |
| LOTUS | LTS0175964 |
| wikiData | Q105243108 |