1,3-Dihydroxy-2-methoxy-10-methylacridin-9(10H)-one
| Internal ID | 0beb1464-eab5-4052-a379-aa8e50513fb1 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1,3-dihydroxy-2-methoxy-10-methylacridin-9-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H13NO4/c1-16-9-6-4-3-5-8(9)13(18)12-10(16)7-11(17)15(20-2)14(12)19/h3-7,17,19H,1-2H3 |
| InChI Key | MEIZZDBRRJMWCJ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 70.00 Ų |
| XlogP | 2.90 |
| 9-Acridanone, 1,3-dihydroxy-2-methoxy-10-methyl- |
| 1,3-Dihydroxy-2-methoxy-10-methylacridin-9(10H)-one |
| 9(10H)-Acridinone, 1,3-dihydroxy-2-methoxy-10-methyl- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.76% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.08% | 93.99% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.02% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.79% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.31% | 85.14% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.56% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.13% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.10% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.92% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.35% | 96.09% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 88.17% | 100.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 86.77% | 80.78% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.31% | 98.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.46% | 99.15% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.64% | 93.65% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 84.38% | 92.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.50% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.50% | 90.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 82.15% | 91.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum leprieurii |
| PubChem | 91739029 |
| LOTUS | LTS0168469 |
| wikiData | Q105162265 |