1,3-Dihydroxy-10-methyl-2,4-bis(3-methylbut-2-enyl)acridin-9-one
| Internal ID | b717cd7c-70c3-4248-98f4-cdec7b15074b |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1,3-dihydroxy-10-methyl-2,4-bis(3-methylbut-2-enyl)acridin-9-one |
| SMILES (Canonical) | CC(=CCC1=C2C(=C(C(=C1O)CC=C(C)C)O)C(=O)C3=CC=CC=C3N2C)C |
| SMILES (Isomeric) | CC(=CCC1=C2C(=C(C(=C1O)CC=C(C)C)O)C(=O)C3=CC=CC=C3N2C)C |
| InChI | InChI=1S/C24H27NO3/c1-14(2)10-12-17-21-20(24(28)18(22(17)26)13-11-15(3)4)23(27)16-8-6-7-9-19(16)25(21)5/h6-11,26,28H,12-13H2,1-5H3 |
| InChI Key | FFLLOFKPQAEMTN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.19909372 g/mol |
| Topological Polar Surface Area (TPSA) | 60.80 Ų |
| XlogP | 6.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.05% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.37% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.35% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.21% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.09% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.96% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.42% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.99% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.51% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.69% | 90.08% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.29% | 98.59% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.76% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.60% | 99.23% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 80.30% | 85.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Atalantia buxifolia |
| PubChem | 14539836 |
| LOTUS | LTS0073582 |
| wikiData | Q104994532 |