N,N'-Dicyclohexylurea
| Internal ID | a23eb030-f3e9-417e-bf32-a0b5f4798c8b |
| Taxonomy | Organic acids and derivatives > Organic carbonic acids and derivatives > Ureas |
| IUPAC Name | 1,3-dicyclohexylurea |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H24N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16) |
| InChI Key | ADFXKUOMJKEIND-UHFFFAOYSA-N |
| Popularity | 340 references in papers |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.188863393 g/mol |
| Topological Polar Surface Area (TPSA) | 41.10 Ų |
| XlogP | 3.00 |
| Atomic LogP (AlogP) | 2.95 |
| H-Bond Acceptor | 1 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 2 |
| 2387-23-7 |
| n,n'-dicyclohexylurea |
| ZV7823VVIM |
| NSC-17013 |
| NSC-30023 |
| DCU compound |
| RefChem:414332 |
| 219-213-7 |
| Dicyclohexylurea |
| Urea, N,N'-dicyclohexyl- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9833 | 98.33% |
| Caco-2 | - | 0.5735 | 57.35% |
| Blood Brain Barrier | + | 0.9250 | 92.50% |
| Human oral bioavailability | + | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.5529 | 55.29% |
| OATP2B1 inhibitior | - | 0.8514 | 85.14% |
| OATP1B1 inhibitior | + | 0.9765 | 97.65% |
| OATP1B3 inhibitior | + | 0.9472 | 94.72% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.6750 | 67.50% |
| BSEP inhibitior | - | 0.8019 | 80.19% |
| P-glycoprotein inhibitior | - | 0.9384 | 93.84% |
| P-glycoprotein substrate | - | 0.9691 | 96.91% |
| CYP3A4 substrate | - | 0.7148 | 71.48% |
| CYP2C9 substrate | - | 0.6039 | 60.39% |
| CYP2D6 substrate | - | 0.7375 | 73.75% |
| CYP3A4 inhibition | - | 0.8803 | 88.03% |
| CYP2C9 inhibition | - | 0.7807 | 78.07% |
| CYP2C19 inhibition | - | 0.6251 | 62.51% |
| CYP2D6 inhibition | - | 0.9800 | 98.00% |
| CYP1A2 inhibition | - | 0.9285 | 92.85% |
| CYP2C8 inhibition | - | 0.9793 | 97.93% |
| CYP inhibitory promiscuity | + | 0.5000 | 50.00% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.7800 | 78.00% |
| Carcinogenicity (trinary) | Non-required | 0.7303 | 73.03% |
| Eye corrosion | - | 0.8386 | 83.86% |
| Eye irritation | + | 0.6321 | 63.21% |
| Skin irritation | - | 0.7826 | 78.26% |
| Skin corrosion | - | 0.8373 | 83.73% |
| Ames mutagenesis | - | 0.8700 | 87.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6268 | 62.68% |
| Micronuclear | - | 0.6300 | 63.00% |
| Hepatotoxicity | + | 0.6782 | 67.82% |
| skin sensitisation | - | 0.9449 | 94.49% |
| Respiratory toxicity | - | 0.6556 | 65.56% |
| Reproductive toxicity | + | 0.5077 | 50.77% |
| Mitochondrial toxicity | - | 0.6625 | 66.25% |
| Nephrotoxicity | - | 0.6520 | 65.20% |
| Acute Oral Toxicity (c) | III | 0.6882 | 68.82% |
| Estrogen receptor binding | + | 0.6428 | 64.28% |
| Androgen receptor binding | - | 0.8215 | 82.15% |
| Thyroid receptor binding | - | 0.6285 | 62.85% |
| Glucocorticoid receptor binding | - | 0.7773 | 77.73% |
| Aromatase binding | + | 0.5232 | 52.32% |
| PPAR gamma | - | 0.7848 | 78.48% |
| Honey bee toxicity | - | 0.9689 | 96.89% |
| Biodegradation | - | 0.6250 | 62.50% |
| Crustacea aquatic toxicity | - | 0.7600 | 76.00% |
| Fish aquatic toxicity | + | 0.6793 | 67.93% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
44668.4 nM |
Potency |
via CMAUP
|
| CHEMBL340 | P08684 | Cytochrome P450 3A4 |
3162.3 nM 3162.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL2409 | P34913 | Epoxide hydratase |
52 nM 3 nM 5.1 nM 52 nM 25.3 nM 3 nM 25 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 22079754
via Super-PRED PMID: 24685540 PMID: 17616115 PMID: 24656800 PMID: 24685540 PMID: 27096037 |
| CHEMBL1968 | P07099 | Epoxide hydrolase 1 |
160 nM 90 nM 100 nM 100 nM 160 nM 160 nM |
IC50 IC50 IC50 IC50 IC50 IC50 |
via Super-PRED
via Super-PRED via Super-PRED via Super-PRED DOI: 10.1007/s00044-011-9953-1 via CMAUP |
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
35481.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.06% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.48% | 91.19% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.31% | 93.03% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.63% | 96.38% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 84.41% | 98.24% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.18% | 92.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.18% | 94.33% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 82.81% | 99.29% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.96% | 94.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.79% | 95.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.37% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Portulaca oleracea |
| PubChem | 4277 |
| NPASS | NPC110136 |
| ChEMBL | CHEMBL1458 |