1,3-Benzodioxole-5-carboxaldehyde, 6,7-dimethoxy-
| Internal ID | f8c63d0b-b635-4f9b-827b-85318318de1f |
| Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
| IUPAC Name | 6,7-dimethoxy-1,3-benzodioxole-5-carbaldehyde |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H10O5/c1-12-8-6(4-11)3-7-9(10(8)13-2)15-5-14-7/h3-4H,5H2,1-2H3 |
| InChI Key | GWFYXQGVKQUWFF-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 54.00 Ų |
| XlogP | 1.10 |
| 1,3-benzodioxole-5-carboxaldehyde, 6,7-dimethoxy- |
| 6,7-dimethoxy-1,3-benzodioxole-5-carbaldehyde |
| 1,3-Benzodioxole-5-carboxaldehyde,6,7-dimethoxy- |
| 6,7-Dimethoxybenzo[d][1,3]dioxole-5-carbaldehyde |
| 6,7-Dimethoxy-2H-1,3-benzodioxole-5-carbaldehyde |
| Dillapiole aldehyde |
| 6,7-dimethoxy-2H-benzo[d]1,3-dioxolene-5-carbaldehyde |
| SCHEMBL30433465 |
| DTXSID70946527 |
| GWFYXQGVKQUWFF-UHFFFAOYSA-N |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.28% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.75% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.64% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.11% | 94.45% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.30% | 98.11% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 89.15% | 80.96% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.88% | 86.33% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.92% | 94.80% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.64% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.11% | 90.00% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 85.11% | 82.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.69% | 96.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.11% | 92.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.83% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper hispidum |
| PubChem | 185549 |
| LOTUS | LTS0219572 |
| wikiData | Q82924129 |