13-alpha-Hydroxymultiflorine
Internal ID | 927cebda-334c-4788-9e08-28f786c9c493 |
Taxonomy | Organoheterocyclic compounds > Quinolizidines |
IUPAC Name | (1S,2R,9S,10S,12S)-12-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-5-en-4-one |
SMILES (Canonical) | C1CN2CC3CC(C2CC1O)CN4C3CC(=O)C=C4 |
SMILES (Isomeric) | C1CN2C[C@@H]3C[C@H]([C@@H]2C[C@H]1O)CN4[C@@H]3CC(=O)C=C4 |
InChI | InChI=1S/C15H22N2O2/c18-12-1-3-16-8-10-5-11(14(16)6-12)9-17-4-2-13(19)7-15(10)17/h1,3,10-11,13-15,19H,2,4-9H2/t10-,11-,13-,14+,15-/m0/s1 |
InChI Key | WADQXAAHRPKPQW-RCZQDCHWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H22N2O2 |
Molecular Weight | 262.35 g/mol |
Exact Mass | 262.168127949 g/mol |
Topological Polar Surface Area (TPSA) | 43.80 Ų |
XlogP | 0.60 |
InChI=1/C15H22N2O2/c18-12-1-3-16-8-10-5-11(14(16)6-12)9-17-4-2-13(19)7-15(10)17/h1,3,10-11,13-15,19H,2,4-9H2/t10?,11?,13-,14-,15-/m0/s |
![2D Structure of 13-alpha-Hydroxymultiflorine 2D Structure of 13-alpha-Hydroxymultiflorine](https://plantaedb.com/storage/docs/compounds/2023/11/13-alpha-hydroxymultiflorine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.47% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.56% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.73% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.24% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.88% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.86% | 93.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.33% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.31% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.00% | 94.45% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 81.86% | 91.76% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.51% | 90.71% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.48% | 82.69% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.06% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lupinus albescens |
Lupinus albus |
Lupinus angustifolius |
Lupinus pilosus |
PubChem | 15939900 |
LOTUS | LTS0117644 |
wikiData | Q104254365 |