1(2H)-Naphthalenone, 3,4-dihydro-4,5-dihydroxy-, (S)-
| Internal ID | 2160f693-f8da-47ef-ab13-f17e23d5bdcb |
| Taxonomy | Benzenoids > Tetralins |
| IUPAC Name | (4S)-4,5-dihydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES (Canonical) | C1CC(=O)C2=C(C1O)C(=CC=C2)O |
| SMILES (Isomeric) | C1CC(=O)C2=C([C@H]1O)C(=CC=C2)O |
| InChI | InChI=1S/C10H10O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-3,9,12-13H,4-5H2/t9-/m0/s1 |
| InChI Key | RSPQGKRRFSZVPZ-VIFPVBQESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 0.60 |
| 1(2H)-Naphthalenone, 3,4-dihydro-4,5-dihydroxy-, (S)- |
| RSPQGKRRFSZVPZ-VIFPVBQESA-N |
| 4,5-Dihydroxy-3,4-dihydro-1(2H)-naphthalenone # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.72% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.91% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.13% | 95.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 92.04% | 93.03% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.20% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.09% | 99.23% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.72% | 93.40% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.33% | 82.69% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.34% | 94.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.84% | 92.94% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.45% | 97.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.82% | 98.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.80% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.66% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.21% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.16% | 90.71% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.78% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.47% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Juglans regia |
| Juglans sigillata |
| PubChem | 22217226 |
| LOTUS | LTS0123907 |
| wikiData | Q105244802 |