[(1R,2R,3aR,5R,6Z,10Z,13R,13aS)-1,2,3a-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,13,13a-tetrahydro-1H-cyclopenta[12]annulen-13-yl] acetate
| Internal ID | c09a74b5-5788-43c3-bf96-3800545a0fd1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Jatrophane and cyclojatrophane diterpenoids |
| IUPAC Name | [(1R,2R,3aR,5R,6Z,10Z,13R,13aS)-1,2,3a-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,13,13a-tetrahydro-1H-cyclopenta[12]annulen-13-yl] acetate |
| SMILES (Canonical) | CC1C=CC(C(=O)C=CC(=C)C(C2C(C(CC2(C1=O)OC(=O)C)(C)OC(=O)C)OC(=O)C)OC(=O)C)(C)C |
| SMILES (Isomeric) | C[C@@H]1/C=C\C(C(=O)/C=C\C(=C)[C@@H]([C@H]2[C@H]([C@](C[C@@]2(C1=O)OC(=O)C)(C)OC(=O)C)OC(=O)C)OC(=O)C)(C)C |
| InChI | InChI=1S/C28H36O10/c1-15-10-11-21(33)26(7,8)13-12-16(2)24(34)28(38-20(6)32)14-27(9,37-19(5)31)25(36-18(4)30)22(28)23(15)35-17(3)29/h10-13,16,22-23,25H,1,14H2,2-9H3/b11-10-,13-12-/t16-,22+,23+,25-,27-,28-/m1/s1 |
| InChI Key | UXVRDUFFNLUIPX-CGRRHHLWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C28H36O10 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23084734 g/mol |
| Topological Polar Surface Area (TPSA) | 139.00 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
![2D Structure of [(1R,2R,3aR,5R,6Z,10Z,13R,13aS)-1,2,3a-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,13,13a-tetrahydro-1H-cyclopenta[12]annulen-13-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/12e78980-858a-11ee-b822-eb24b64ba221.jpg "2D Structure of [(1R,2R,3aR,5R,6Z,10Z,13R,13aS)-1,2,3a-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-3,5,13,13a-tetrahydro-1H-cyclopenta[12]annulen-13-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.10% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.92% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.92% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.85% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.21% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.92% | 91.19% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.05% | 85.14% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.40% | 91.24% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.49% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.08% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.52% | 91.49% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.59% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.53% | 89.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.29% | 82.69% |
| CHEMBL5028 | O14672 | ADAM10 | 80.56% | 97.50% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.32% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia esula |
| PubChem | 163005323 |
| LOTUS | LTS0098907 |
| wikiData | Q105281078 |