CID 139584533
| Internal ID | 94e13834-5591-4bab-8c94-091e065e3002 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | (2R,3S)-2-[[(3S)-2-[(2R)-2-[[(2S)-2-[[(3R)-2-[(2S,3S)-2-[[2-[(2R,5S,6S)-6-[(2E,4S,6E)-4,6-dimethyl-5-oxoocta-2,6-dien-2-yl]-2-hydroxy-5-methyloxan-2-yl]-2-hydroxypropanoyl]amino]-3-hydroxy-4-methylpentanoyl]diazinane-3-carbonyl]-hydroxyamino]propanoyl]-methylamino]-4-methylpentanoyl]diazinane-3-carbonyl]amino]-3-hydroxybutanoic acid |
| SMILES (Canonical) | CC=C(C)C(=O)C(C)C=C(C)C1C(CCC(O1)(C(C)(C(=O)NC(C(C(C)C)O)C(=O)N2C(CCCN2)C(=O)N(C(C)C(=O)N(C)C(CC(C)C)C(=O)N3C(CCCN3)C(=O)NC(C(C)O)C(=O)O)O)O)O)C |
| SMILES (Isomeric) | C/C=C(\C)/C(=O)[C@@H](C)/C=C(\C)/[C@@H]1[C@H](CC[C@@](O1)(C(C)(C(=O)N[C@@H]([C@H](C(C)C)O)C(=O)N2[C@H](CCCN2)C(=O)N([C@@H](C)C(=O)N(C)[C@H](CC(C)C)C(=O)N3[C@@H](CCCN3)C(=O)N[C@H]([C@H](C)O)C(=O)O)O)O)O)C |
| InChI | InChI=1S/C49H82N8O15/c1-14-27(6)39(60)29(8)24-30(9)40-28(7)19-20-49(70,72-40)48(12,69)47(68)53-37(38(59)26(4)5)45(65)56-34(18-16-22-51-56)44(64)57(71)31(10)42(62)54(13)35(23-25(2)3)43(63)55-33(17-15-21-50-55)41(61)52-36(32(11)58)46(66)67/h14,24-26,28-29,31-38,40,50-51,58-59,69-71H,15-23H2,1-13H3,(H,52,61)(H,53,68)(H,66,67)/b27-14+,30-24+/t28-,29-,31-,32-,33-,34+,35+,36+,37-,38-,40-,48?,49+/m0/s1 |
| InChI Key | JZHHEDXKUYAXEI-XEOSYUJQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C49H82N8O15 |
| Molecular Weight | 1023.20 g/mol |
| Exact Mass | 1022.58996394 g/mol |
| Topological Polar Surface Area (TPSA) | 328.00 Ų |
| XlogP | 0.20 |
| Atomic LogP (AlogP) | 0.28 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 21 |
| CHEBI:202374 |
| (2R,3S)-2-[[(3S)-2-[(2R)-2-[[(2S)-2-[[(3R)-2-[(2S,3S)-2-[[2-[(2R,5S,6S)-6-[(2E,4S,6E)-4,6-dimethyl-5-oxoocta-2,6-dien-2-yl]-2-hydroxy-5-methyloxan-2-yl]-2-hydroxypropanoyl]amino]-3-hydroxy-4-methylpentanoyl]diazinane-3-carbonyl]-hydroxyamino]propanoyl]-methylamino]-4-methylpentanoyl]diazinane-3-carbonyl]amino]-3-hydroxybutanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.6776 | 67.76% |
| Caco-2 | - | 0.8613 | 86.13% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.6857 | 68.57% |
| Subcellular localzation | Mitochondria | 0.5221 | 52.21% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8253 | 82.53% |
| OATP1B3 inhibitior | + | 0.9257 | 92.57% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9181 | 91.81% |
| P-glycoprotein inhibitior | + | 0.7425 | 74.25% |
| P-glycoprotein substrate | + | 0.8164 | 81.64% |
| CYP3A4 substrate | + | 0.7404 | 74.04% |
| CYP2C9 substrate | - | 0.7976 | 79.76% |
| CYP2D6 substrate | - | 0.8743 | 87.43% |
| CYP3A4 inhibition | - | 0.8389 | 83.89% |
| CYP2C9 inhibition | - | 0.7338 | 73.38% |
| CYP2C19 inhibition | - | 0.7096 | 70.96% |
| CYP2D6 inhibition | - | 0.8933 | 89.33% |
| CYP1A2 inhibition | - | 0.7965 | 79.65% |
| CYP2C8 inhibition | + | 0.7375 | 73.75% |
| CYP inhibitory promiscuity | - | 0.9786 | 97.86% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8300 | 83.00% |
| Carcinogenicity (trinary) | Non-required | 0.4358 | 43.58% |
| Eye corrosion | - | 0.9796 | 97.96% |
| Eye irritation | - | 0.8986 | 89.86% |
| Skin irritation | - | 0.7527 | 75.27% |
| Skin corrosion | - | 0.9146 | 91.46% |
| Ames mutagenesis | - | 0.6500 | 65.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3938 | 39.38% |
| Micronuclear | + | 0.7600 | 76.00% |
| Hepatotoxicity | - | 0.5398 | 53.98% |
| skin sensitisation | - | 0.8233 | 82.33% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.9111 | 91.11% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | - | 0.8716 | 87.16% |
| Acute Oral Toxicity (c) | III | 0.5982 | 59.82% |
| Estrogen receptor binding | + | 0.7836 | 78.36% |
| Androgen receptor binding | + | 0.7587 | 75.87% |
| Thyroid receptor binding | + | 0.6510 | 65.10% |
| Glucocorticoid receptor binding | + | 0.7286 | 72.86% |
| Aromatase binding | + | 0.6558 | 65.58% |
| PPAR gamma | + | 0.8157 | 81.57% |
| Honey bee toxicity | - | 0.6873 | 68.73% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.6300 | 63.00% |
| Fish aquatic toxicity | + | 0.6786 | 67.86% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.89% | 96.61% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.53% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.44% | 98.95% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 98.81% | 98.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.20% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.18% | 93.56% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 96.81% | 94.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 96.50% | 97.14% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 95.44% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.07% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.04% | 96.47% |
| CHEMBL4072 | P07858 | Cathepsin B | 95.03% | 93.67% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 94.74% | 85.31% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.19% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.16% | 91.11% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 92.86% | 97.50% |
| CHEMBL236 | P41143 | Delta opioid receptor | 92.73% | 99.35% |
| CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 | 92.20% | 93.85% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.94% | 90.17% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 91.84% | 91.03% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.70% | 95.71% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 91.43% | 97.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.35% | 90.08% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 90.76% | 89.50% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.53% | 89.63% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.68% | 89.00% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 89.61% | 97.86% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.05% | 93.00% |
| CHEMBL204 | P00734 | Thrombin | 88.36% | 96.01% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 88.28% | 92.12% |
| CHEMBL233 | P35372 | Mu opioid receptor | 87.78% | 97.93% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.64% | 91.19% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 87.12% | 95.36% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.06% | 93.04% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 87.01% | 95.52% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 86.72% | 96.37% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 85.86% | 97.47% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.62% | 98.33% |
| CHEMBL5028 | O14672 | ADAM10 | 85.46% | 97.50% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 84.66% | 94.66% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.54% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.42% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.39% | 95.89% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 83.22% | 96.31% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.18% | 97.50% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.80% | 92.88% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 82.75% | 96.67% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 82.59% | 97.64% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 82.22% | 97.64% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.00% | 88.56% |
| CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 81.59% | 100.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.51% | 85.11% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 81.45% | 92.80% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.41% | 98.05% |
| CHEMBL268 | P43235 | Cathepsin K | 81.15% | 96.85% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.05% | 95.50% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.83% | 93.03% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 80.82% | 96.28% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.74% | 99.17% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 80.61% | 98.24% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.57% | 90.93% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.36% | 95.56% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.26% | 95.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.14% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584533 |
| LOTUS | LTS0234544 |
| wikiData | Q77370956 |