(2S,3R,4E,8E)-1-(beta-D-Glucopyranosyloxy)-2-[[(2R)-2-hydroxypentadecanoyl]amino]-4,8-octadecadiene-3-ol
Internal ID | 8d03b962-fbf4-4d3e-a8f1-fac98f60b5bf |
Taxonomy | Lipids and lipid-like molecules > Sphingolipids > Glycosphingolipids > Simple glycosylceramides > Glycosyl-N-acylsphingosines |
IUPAC Name | (2R)-2-hydroxy-N-[(2S,3R,4E,8E)-3-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadeca-4,8-dien-2-yl]pentadecanamide |
SMILES (Canonical) | CCCCCCCCCCCCCC(C(=O)NC(COC1C(C(C(C(O1)CO)O)O)O)C(C=CCCC=CCCCCCCCCC)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCC[C@H](C(=O)N[C@@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)[C@@H](/C=C/CC/C=C/CCCCCCCCC)O)O |
InChI | InChI=1S/C39H73NO9/c1-3-5-7-9-11-13-15-16-18-19-21-23-25-27-32(42)31(30-48-39-37(46)36(45)35(44)34(29-41)49-39)40-38(47)33(43)28-26-24-22-20-17-14-12-10-8-6-4-2/h18-19,25,27,31-37,39,41-46H,3-17,20-24,26,28-30H2,1-2H3,(H,40,47)/b19-18+,27-25+/t31-,32+,33+,34+,35+,36-,37+,39+/m0/s1 |
InChI Key | NHVGKAGJOWJYCD-XDIPGYKVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H73NO9 |
Molecular Weight | 700.00 g/mol |
Exact Mass | 699.52853291 g/mol |
Topological Polar Surface Area (TPSA) | 169.00 Ų |
XlogP | 9.10 |
Atomic LogP (AlogP) | 5.74 |
H-Bond Acceptor | 9 |
H-Bond Donor | 7 |
Rotatable Bonds | 31 |
There are no found synonyms. |
![2D Structure of (2S,3R,4E,8E)-1-(beta-D-Glucopyranosyloxy)-2-[[(2R)-2-hydroxypentadecanoyl]amino]-4,8-octadecadiene-3-ol 2D Structure of (2S,3R,4E,8E)-1-(beta-D-Glucopyranosyloxy)-2-[[(2R)-2-hydroxypentadecanoyl]amino]-4,8-octadecadiene-3-ol](https://plantaedb.com/storage/docs/compounds/2023/07/12b1afb0-24a6-11ee-b5bd-f70a75fba469.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.5446 | 54.46% |
Caco-2 | - | 0.8735 | 87.35% |
Blood Brain Barrier | - | 0.7500 | 75.00% |
Human oral bioavailability | - | 0.7429 | 74.29% |
Subcellular localzation | Mitochondria | 0.7599 | 75.99% |
OATP2B1 inhibitior | - | 0.5687 | 56.87% |
OATP1B1 inhibitior | + | 0.8186 | 81.86% |
OATP1B3 inhibitior | + | 0.9225 | 92.25% |
MATE1 inhibitior | - | 0.9612 | 96.12% |
OCT2 inhibitior | - | 0.9000 | 90.00% |
BSEP inhibitior | + | 0.8347 | 83.47% |
P-glycoprotein inhibitior | + | 0.6363 | 63.63% |
P-glycoprotein substrate | - | 0.6545 | 65.45% |
CYP3A4 substrate | + | 0.6495 | 64.95% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8690 | 86.90% |
CYP3A4 inhibition | - | 0.6831 | 68.31% |
CYP2C9 inhibition | - | 0.9257 | 92.57% |
CYP2C19 inhibition | - | 0.8752 | 87.52% |
CYP2D6 inhibition | - | 0.8066 | 80.66% |
CYP1A2 inhibition | - | 0.8743 | 87.43% |
CYP2C8 inhibition | - | 0.6327 | 63.27% |
CYP inhibitory promiscuity | - | 0.8687 | 86.87% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9500 | 95.00% |
Carcinogenicity (trinary) | Non-required | 0.7098 | 70.98% |
Eye corrosion | - | 0.9902 | 99.02% |
Eye irritation | - | 0.9148 | 91.48% |
Skin irritation | - | 0.7583 | 75.83% |
Skin corrosion | - | 0.9553 | 95.53% |
Ames mutagenesis | - | 0.8600 | 86.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6824 | 68.24% |
Micronuclear | - | 0.5100 | 51.00% |
Hepatotoxicity | - | 0.8450 | 84.50% |
skin sensitisation | - | 0.8789 | 87.89% |
Respiratory toxicity | - | 0.5556 | 55.56% |
Reproductive toxicity | + | 0.6778 | 67.78% |
Mitochondrial toxicity | + | 0.7750 | 77.50% |
Nephrotoxicity | + | 0.4750 | 47.50% |
Acute Oral Toxicity (c) | III | 0.6732 | 67.32% |
Estrogen receptor binding | + | 0.7568 | 75.68% |
Androgen receptor binding | - | 0.5343 | 53.43% |
Thyroid receptor binding | - | 0.5825 | 58.25% |
Glucocorticoid receptor binding | - | 0.5411 | 54.11% |
Aromatase binding | + | 0.5567 | 55.67% |
PPAR gamma | + | 0.6188 | 61.88% |
Honey bee toxicity | - | 0.8637 | 86.37% |
Biodegradation | - | 0.6000 | 60.00% |
Crustacea aquatic toxicity | + | 0.5671 | 56.71% |
Fish aquatic toxicity | - | 0.4074 | 40.74% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.87% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.71% | 99.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.39% | 93.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.85% | 96.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.63% | 92.86% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.57% | 97.29% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.60% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.17% | 92.08% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 92.49% | 92.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.79% | 91.24% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.98% | 94.73% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.51% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 90.23% | 94.33% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 89.94% | 85.94% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.76% | 90.17% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.66% | 96.47% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.30% | 89.63% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 89.17% | 91.81% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.42% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.55% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.80% | 96.95% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 86.79% | 82.50% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.18% | 89.34% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.78% | 92.88% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.17% | 92.32% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.12% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.68% | 91.19% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.67% | 97.47% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.38% | 89.50% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.73% | 96.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.52% | 97.21% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.55% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium sativum |
Aniba megaphylla |
Berberis integerrima |
Calocedrus decurrens |
Digitalis sceptrum |
Herbertus sakuraii |
Nauclea latifolia |
Orthopappus angustifolius |
Scurrula parasitica |
PubChem | 10628502 |
NPASS | NPC272256 |
LOTUS | LTS0157949 |
wikiData | Q105179620 |