1,2,9,10-Tetramethoxy-6,7-dimethyl-5,6-dihydro-4h-dibenzo[de,g]quinoline
| Internal ID | aedb0bf9-6235-49ea-9f6c-deca2c0266d2 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 4,5,15,16-tetramethoxy-8,10-dimethyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene |
| SMILES (Canonical) | CC1=C2C3=C(C4=CC(=C(C=C14)OC)OC)C(=C(C=C3CCN2C)OC)OC |
| SMILES (Isomeric) | CC1=C2C3=C(C4=CC(=C(C=C14)OC)OC)C(=C(C=C3CCN2C)OC)OC |
| InChI | InChI=1S/C22H25NO4/c1-12-14-10-16(24-3)17(25-4)11-15(14)20-19-13(7-8-23(2)21(12)19)9-18(26-5)22(20)27-6/h9-11H,7-8H2,1-6H3 |
| InChI Key | RBCAXOSUUINIHP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17835828 g/mol |
| Topological Polar Surface Area (TPSA) | 40.20 Ų |
| XlogP | 4.80 |
| SCHEMBL14029531 |
| 1,2,9,10-tetramethoxy-6,7-dimethyl-5,6-dihydro-4h-dibenzo[de,g]quinoline |
| AKOS024282945 |
| NCGC00142569-01 |
| Q63399172 |
![2D Structure of 1,2,9,10-Tetramethoxy-6,7-dimethyl-5,6-dihydro-4h-dibenzo[de,g]quinoline](https://plantaedb.com/storage/docs/compounds/2023/11/12910-tetramethoxy-67-dimethyl-56-dihydro-4h-dibenzodegquinoline.jpg "2D Structure of 1,2,9,10-Tetramethoxy-6,7-dimethyl-5,6-dihydro-4h-dibenzo[de,g]quinoline")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 95.29% | 92.98% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.20% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.67% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.27% | 94.00% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 93.22% | 95.70% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.51% | 95.56% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 90.53% | 95.12% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 90.46% | 91.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.60% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.56% | 92.94% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.36% | 90.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 87.50% | 96.43% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 85.31% | 95.34% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.10% | 95.89% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.02% | 93.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.17% | 98.75% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 82.46% | 92.38% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.37% | 89.00% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 82.01% | 96.47% |
| CHEMBL6031 | Q9H9B1 | Histone-lysine N-methyltransferase, H3 lysine-9 specific 5 | 81.54% | 94.33% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.68% | 82.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Corydalis turtschaninovii |
| PubChem | 53073 |
| LOTUS | LTS0087200 |
| wikiData | Q63399172 |