1,2,9,10-Tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline
Internal ID | 98c2d9f7-ae5a-4658-93b6-05106841f8ce |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)OC)OC)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)OC)OC)OC |
InChI | InChI=1S/C21H25NO4/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3 |
InChI Key | RUZIUYOSRDWYQF-UHFFFAOYSA-N |
Popularity | 243 references in papers |
Molecular Formula | C21H25NO4 |
Molecular Weight | 355.40 g/mol |
Exact Mass | 355.17835828 g/mol |
Topological Polar Surface Area (TPSA) | 40.20 Ų |
XlogP | 3.40 |
Atomic LogP (AlogP) | 3.47 |
H-Bond Acceptor | 5 |
H-Bond Donor | 0 |
Rotatable Bonds | 4 |
1,2,9,10-Tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
2,3,5,6-Tetramethoxyaporphine |
MLS000111916 |
EINECS 227-068-6 |
SMR000107835 |
(1)-5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo(de,g)quinoline |
5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo(de,g)quinoline |
tussiglaucin |
Glaucine, dl |
glaucine phosphate |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of 1,2,9,10-Tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline 2D Structure of 1,2,9,10-Tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline](https://plantaedb.com/storage/docs/compounds/2023/07/12910-tetramethoxy-6-methyl-566a7-tetrahydro-4h-dibenzodegquinoline.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9660 | 96.60% |
Caco-2 | + | 0.9424 | 94.24% |
Blood Brain Barrier | + | 0.7750 | 77.50% |
Human oral bioavailability | - | 0.5857 | 58.57% |
Subcellular localzation | Mitochondria | 0.5029 | 50.29% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9407 | 94.07% |
OATP1B3 inhibitior | + | 0.9553 | 95.53% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.5250 | 52.50% |
BSEP inhibitior | + | 0.6810 | 68.10% |
P-glycoprotein inhibitior | + | 0.5977 | 59.77% |
P-glycoprotein substrate | - | 0.7575 | 75.75% |
CYP3A4 substrate | + | 0.5987 | 59.87% |
CYP2C9 substrate | + | 0.7753 | 77.53% |
CYP2D6 substrate | + | 0.8760 | 87.60% |
CYP3A4 inhibition | - | 0.7573 | 75.73% |
CYP2C9 inhibition | - | 0.8952 | 89.52% |
CYP2C19 inhibition | - | 0.8505 | 85.05% |
CYP2D6 inhibition | + | 0.8751 | 87.51% |
CYP1A2 inhibition | + | 0.6793 | 67.93% |
CYP2C8 inhibition | - | 0.8309 | 83.09% |
CYP inhibitory promiscuity | - | 0.9046 | 90.46% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6801 | 68.01% |
Eye corrosion | - | 0.9925 | 99.25% |
Eye irritation | - | 0.9711 | 97.11% |
Skin irritation | - | 0.7550 | 75.50% |
Skin corrosion | - | 0.9376 | 93.76% |
Ames mutagenesis | + | 0.7400 | 74.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8133 | 81.33% |
Micronuclear | - | 0.5800 | 58.00% |
Hepatotoxicity | - | 0.7824 | 78.24% |
skin sensitisation | - | 0.9048 | 90.48% |
Respiratory toxicity | + | 0.7444 | 74.44% |
Reproductive toxicity | + | 0.8444 | 84.44% |
Mitochondrial toxicity | + | 0.5500 | 55.00% |
Nephrotoxicity | - | 0.8624 | 86.24% |
Acute Oral Toxicity (c) | III | 0.8078 | 80.78% |
Estrogen receptor binding | + | 0.7152 | 71.52% |
Androgen receptor binding | - | 0.5971 | 59.71% |
Thyroid receptor binding | + | 0.6529 | 65.29% |
Glucocorticoid receptor binding | + | 0.7637 | 76.37% |
Aromatase binding | - | 0.5718 | 57.18% |
PPAR gamma | + | 0.6364 | 63.64% |
Honey bee toxicity | - | 0.8707 | 87.07% |
Biodegradation | - | 0.9500 | 95.00% |
Crustacea aquatic toxicity | + | 0.7600 | 76.00% |
Fish aquatic toxicity | + | 0.9042 | 90.42% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL2334 | P42574 | Caspase-3 |
907 nM |
IC50 |
via CMAUP
|
CHEMBL2362978 | P43351 | DNA repair protein RAD52 homolog |
2140 nM |
AC50 |
via CMAUP
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
25118.9 nM 39810.7 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
14125.4 nM |
Potency |
via CMAUP
|
CHEMBL1741215 | Q9GZR1 | Sentrin-specific protease 6 |
1860 nM |
IC50 |
via CMAUP
|
CHEMBL1741213 | Q9BQF6 | Sentrin-specific protease 7 |
4630 nM |
IC50 |
via CMAUP
|
CHEMBL1741207 | Q96LD8 | Sentrin-specific protease 8 |
5470 nM |
IC50 |
via CMAUP
|
CHEMBL214 | P08908 | Serotonin 1a (5-HT1a) receptor |
171 nM |
Ki |
via Super-PRED
|
CHEMBL224 | P28223 | Serotonin 2a (5-HT2a) receptor |
966 nM |
Ki |
via Super-PRED
|
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor |
43 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.75% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 96.38% | 95.62% |
CHEMBL5747 | Q92793 | CREB-binding protein | 95.40% | 95.12% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 93.92% | 91.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.13% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.87% | 95.56% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 88.08% | 96.86% |
CHEMBL2581 | P07339 | Cathepsin D | 88.02% | 98.95% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.58% | 91.03% |
CHEMBL2535 | P11166 | Glucose transporter | 86.81% | 98.75% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.62% | 88.48% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.42% | 90.00% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.30% | 82.38% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.77% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.43% | 92.94% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 85.43% | 91.79% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 85.40% | 92.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.90% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.74% | 89.62% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 83.02% | 96.76% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.58% | 93.99% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.23% | 94.00% |
CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 80.85% | 89.32% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.81% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.04% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corydalis yanhusuo |
Glaucium flavum |
Papaver somniferum |
PubChem | 10145 |
NPASS | NPC325871 |
ChEMBL | CHEMBL36536 |