1,2,9-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-ol
Internal ID | 1baedbcc-de6d-4488-be51-2e6abfb84c25 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 1,2,9-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-ol |
SMILES (Canonical) | COC1=C(C2=C3C(CC4=CC(=C(C=C42)O)OC)NCCC3=C1)OC |
SMILES (Isomeric) | COC1=C(C2=C3C(CC4=CC(=C(C=C42)O)OC)NCCC3=C1)OC |
InChI | InChI=1S/C19H21NO4/c1-22-15-8-11-6-13-17-10(4-5-20-13)7-16(23-2)19(24-3)18(17)12(11)9-14(15)21/h7-9,13,20-21H,4-6H2,1-3H3 |
InChI Key | VHFFCCOFVYXCRX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H21NO4 |
Molecular Weight | 327.40 g/mol |
Exact Mass | 327.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 60.00 Ų |
XlogP | 2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.19% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.23% | 96.09% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 93.69% | 91.79% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.16% | 93.99% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 91.72% | 88.48% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 91.52% | 95.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.52% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.05% | 92.94% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 90.54% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.23% | 90.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.09% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.83% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 89.16% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.03% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.02% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.37% | 93.03% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.01% | 96.21% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.82% | 92.68% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.52% | 91.03% |
CHEMBL2581 | P07339 | Cathepsin D | 85.16% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.63% | 94.00% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.27% | 91.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.00% | 96.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.05% | 89.62% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.68% | 97.21% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 81.15% | 95.55% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.05% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.25% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.20% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ocotea pittieri |
Ocotea sinuata |
PubChem | 14558225 |
LOTUS | LTS0140036 |
wikiData | Q104394125 |