1,2,9-trihydroxy-3,3-dimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole-5-carbaldehyde
| Internal ID | 0d739ad7-a122-4d7c-b3d4-779fec893206 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 1,2,9-trihydroxy-3,3-dimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole-5-carbaldehyde |
| SMILES (Canonical) | CC1(C(C(C2=C(O1)C(=CC3=C2NC4=C3C=CC(=C4)O)C=O)O)O)C |
| SMILES (Isomeric) | CC1(C(C(C2=C(O1)C(=CC3=C2NC4=C3C=CC(=C4)O)C=O)O)O)C |
| InChI | InChI=1S/C18H17NO5/c1-18(2)17(23)15(22)13-14-11(5-8(7-20)16(13)24-18)10-4-3-9(21)6-12(10)19-14/h3-7,15,17,19,21-23H,1-2H3 |
| InChI Key | NKDKVISDCZDDBO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11067264 g/mol |
| Topological Polar Surface Area (TPSA) | 103.00 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of 1,2,9-trihydroxy-3,3-dimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole-5-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/129-trihydroxy-33-dimethyl-211-dihydro-1h-pyrano32-acarbazole-5-carbaldehyde.jpg "2D Structure of 1,2,9-trihydroxy-3,3-dimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole-5-carbaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.74% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.88% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.94% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.71% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.71% | 91.49% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.76% | 91.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.46% | 89.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.88% | 98.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.93% | 98.95% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 87.27% | 98.35% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.65% | 97.28% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.56% | 92.94% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.92% | 90.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.23% | 97.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.22% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.65% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.61% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena excavata |
| PubChem | 162862102 |
| LOTUS | LTS0082006 |
| wikiData | Q105180524 |