1,2,5,7-Tetrahydroxyxanthen-9-one
Internal ID | f6d18801-04c5-4051-8882-d3d735d67f26 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 1,2,5,7-tetrahydroxyxanthen-9-one |
SMILES (Canonical) | C1=CC2=C(C(=C1O)O)C(=O)C3=C(O2)C(=CC(=C3)O)O |
SMILES (Isomeric) | C1=CC2=C(C(=C1O)O)C(=O)C3=C(O2)C(=CC(=C3)O)O |
InChI | InChI=1S/C13H8O6/c14-5-3-6-11(17)10-9(2-1-7(15)12(10)18)19-13(6)8(16)4-5/h1-4,14-16,18H |
InChI Key | TXZJFHOZUHJSHB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H8O6 |
Molecular Weight | 260.20 g/mol |
Exact Mass | 260.03208797 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.93% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.07% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.69% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.65% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 91.59% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.04% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.25% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.68% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 88.13% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.27% | 94.73% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.23% | 94.42% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.00% | 90.71% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.60% | 96.12% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.68% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Maclura cochinchinensis |
PubChem | 162909448 |
LOTUS | LTS0237440 |
wikiData | Q105267183 |