3-[10,13-Dimethyl-16-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,12,14,15,17-decahydrocyclopenta[a]phenanthren-17-yl]-5-(3-methyl-2-propan-2-yloxiran-2-yl)oxolan-2-one
Internal ID | 71b896f2-ae15-4150-ad30-34e32e4a073f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 3-[10,13-dimethyl-16-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,12,14,15,17-decahydrocyclopenta[a]phenanthren-17-yl]-5-(3-methyl-2-propan-2-yloxiran-2-yl)oxolan-2-one |
SMILES (Canonical) | CC1C(O1)(C2CC(C(=O)O2)C3C(=O)CC4C3(CC=C5C4=CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)O)O)C)C)C(C)C |
SMILES (Isomeric) | CC1C(O1)(C2CC(C(=O)O2)C3C(=O)CC4C3(CC=C5C4=CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)O)O)C)C)C(C)C |
InChI | InChI=1S/C35H50O10/c1-16(2)35(17(3)45-35)26-13-21(31(41)44-26)27-24(37)14-23-20-7-6-18-12-19(8-10-33(18,4)22(20)9-11-34(23,27)5)42-32-30(40)29(39)28(38)25(15-36)43-32/h7,9,16-19,21,23,25-30,32,36,38-40H,6,8,10-15H2,1-5H3 |
InChI Key | OGJQOSZFJOEENK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H50O10 |
Molecular Weight | 630.80 g/mol |
Exact Mass | 630.34039779 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of 3-[10,13-Dimethyl-16-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,12,14,15,17-decahydrocyclopenta[a]phenanthren-17-yl]-5-(3-methyl-2-propan-2-yloxiran-2-yl)oxolan-2-one 2D Structure of 3-[10,13-Dimethyl-16-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,12,14,15,17-decahydrocyclopenta[a]phenanthren-17-yl]-5-(3-methyl-2-propan-2-yloxiran-2-yl)oxolan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/1253adc0-86eb-11ee-a5ab-f95b37a246ef.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.77% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.21% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.33% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.67% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.10% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.01% | 96.21% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.62% | 96.61% |
CHEMBL2581 | P07339 | Cathepsin D | 91.53% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.06% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.69% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.04% | 100.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.84% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.28% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.25% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.83% | 95.56% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 86.02% | 94.23% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.66% | 98.10% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.91% | 97.14% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.65% | 92.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.57% | 95.89% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.67% | 95.71% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.10% | 98.05% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.78% | 94.00% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.27% | 96.37% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gymnanthemum amygdalinum |
PubChem | 162894055 |
LOTUS | LTS0087588 |
wikiData | Q105191659 |