5,12-Dihydroxy-6-methoxy-10-methyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),6,9(13),10-tetraene-2,8-dione
| Internal ID | b4911b39-726d-4eeb-aa28-26b53cfd3b80 |
| Taxonomy | Benzenoids > Naphthalenes |
| IUPAC Name | 5,12-dihydroxy-6-methoxy-10-methyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),6,9(13),10-tetraene-2,8-dione |
| SMILES (Canonical) | CC1=CC(=C2C3=C1C(=O)C=C(C3(COC2=O)O)OC)O |
| SMILES (Isomeric) | CC1=CC(=C2C3=C1C(=O)C=C(C3(COC2=O)O)OC)O |
| InChI | InChI=1S/C14H12O6/c1-6-3-7(15)11-12-10(6)8(16)4-9(19-2)14(12,18)5-20-13(11)17/h3-4,15,18H,5H2,1-2H3 |
| InChI Key | SMAURRJHZJPIDC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
![2D Structure of 5,12-Dihydroxy-6-methoxy-10-methyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),6,9(13),10-tetraene-2,8-dione](https://plantaedb.com/storage/docs/compounds/2023/11/1244d730-837f-11ee-af80-c53bf9de8781.jpg "2D Structure of 5,12-Dihydroxy-6-methoxy-10-methyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),6,9(13),10-tetraene-2,8-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.90% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.53% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.24% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.07% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.94% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.77% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.08% | 94.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.55% | 89.63% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.97% | 99.23% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.68% | 93.40% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.11% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.75% | 93.99% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.73% | 91.07% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.78% | 89.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.26% | 96.77% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.35% | 93.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.40% | 96.09% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.17% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162854606 |
| LOTUS | LTS0071021 |
| wikiData | Q104197421 |