1,2,3,4-Tetrahydroisoquinoline, 6,7,8-trimethoxy-1,2-dimethyl-
| Internal ID | 551a553d-6267-4d52-bf70-491972c1de81 |
| Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
| IUPAC Name | 6,7,8-trimethoxy-1,2-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H21NO3/c1-9-12-10(6-7-15(9)2)8-11(16-3)13(17-4)14(12)18-5/h8-9H,6-7H2,1-5H3 |
| InChI Key | SDLPOZWCCRGUOA-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.15214353 g/mol |
| Topological Polar Surface Area (TPSA) | 30.90 Ų |
| XlogP | 2.10 |
| SDLPOZWCCRGUOA-UHFFFAOYSA-N |
| 1,2,3,4-Tetrahydroisoquinoline, 6,7,8-trimethoxy-1,2-dimethyl- |
| BDBM50014643 |
| AKOS000277423 |
| 6,7,8-Trimethoxy-1,2-dimethyl-1,2,3,4-tetrahydroisoquinoline # |
| 6,7,8-Trimethoxy-1,2-dimethyl-1,2,3,4-tetrahydro-isoquinoline; compound with but-2-enedioic acid ((+/-)-o-methylpellotine) |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.47% | 96.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.21% | 93.40% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 92.71% | 97.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.78% | 95.56% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.88% | 91.00% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 86.78% | 96.86% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.89% | 91.03% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.24% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.85% | 86.33% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 84.61% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.19% | 92.94% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.13% | 93.99% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.55% | 95.89% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 82.04% | 95.12% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.79% | 94.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.19% | 82.38% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.17% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pachycereus weberi |
| PubChem | 616880 |
| LOTUS | LTS0110511 |
| wikiData | Q104252929 |