6,7,8-Trimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline
| Internal ID | 8e967c96-7e3f-43c7-ab13-19c76dfaada2 |
| Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
| IUPAC Name | 6,7,8-trimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H19NO3/c1-8-11-9(5-6-14-8)7-10(15-2)12(16-3)13(11)17-4/h7-8,14H,5-6H2,1-4H3 |
| InChI Key | VMFUYWSNWQYUTG-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 39.70 Ų |
| XlogP | 1.60 |
| 1,2,3,4-Tetrahydroisoquinoline, 6,7,8-trimethoxy-1-methyl- |
| O-Methylanhalonidine |
| CHEMBL1178706 |
| VMFUYWSNWQYUTG-UHFFFAOYSA-N |
| 6,7,8-Trimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| BDBM50014642 |
| AKOS000278043 |
| AKOS017472127 |
| 6,7,8-Trimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline # |
| 6,7,8-Trimethoxy-1-methyl-1,2,3,4-tetrahydro-isoquinoline; compound with but-2-enedioic acid ((+/-)-o-methylanhalonidine) |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.21% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.38% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.27% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.42% | 92.94% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.25% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.04% | 86.33% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.03% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.42% | 93.99% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.69% | 95.89% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 83.02% | 94.55% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.81% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.42% | 99.17% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.32% | 96.86% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.14% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gymnocalycium bodenbenderianum |
| Gymnocalycium monvillei |
| PubChem | 613648 |
| LOTUS | LTS0070192 |
| wikiData | Q104375563 |