1,2,3-trimethoxy-7,7-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-4-ol
| Internal ID | 2e93f0fa-b528-480f-945c-757fcb3a2962 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 1,2,3-trimethoxy-7,7-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-4-ol |
| SMILES (Canonical) | CC1(C2C3=C(C4=CC=CC=C41)C(=C(C(=C3C(CN2)O)OC)OC)OC)C |
| SMILES (Isomeric) | CC1(C2C3=C(C4=CC=CC=C41)C(=C(C(=C3C(CN2)O)OC)OC)OC)C |
| InChI | InChI=1S/C21H25NO4/c1-21(2)12-9-7-6-8-11(12)14-16-15(13(23)10-22-20(16)21)18(25-4)19(26-5)17(14)24-3/h6-9,13,20,22-23H,10H2,1-5H3 |
| InChI Key | LGQWKWCRVZSCKZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.17835828 g/mol |
| Topological Polar Surface Area (TPSA) | 60.00 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.33% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.91% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.81% | 82.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.33% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.80% | 98.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.60% | 97.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.60% | 90.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.58% | 90.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.39% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.33% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.23% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.12% | 86.33% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.10% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Guatteria friesiana |
| PubChem | 74975958 |
| LOTUS | LTS0084811 |
| wikiData | Q105151536 |