(12,12-Dimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecan-4-yl)methanol
| Internal ID | b501f83d-2557-4af0-bbd0-1ec1308ee874 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (12,12-dimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecan-4-yl)methanol |
| SMILES (Canonical) | CC1(CC2C1CCC3(C(O3)CCC2=C)CO)C |
| SMILES (Isomeric) | CC1(CC2C1CCC3(C(O3)CCC2=C)CO)C |
| InChI | InChI=1S/C15H24O2/c1-10-4-5-13-15(9-16,17-13)7-6-12-11(10)8-14(12,2)3/h11-13,16H,1,4-9H2,2-3H3 |
| InChI Key | PUIHQHPNBOICHY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 32.80 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
![2D Structure of (12,12-Dimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecan-4-yl)methanol](https://plantaedb.com/storage/docs/compounds/2023/11/1212-dimethyl-9-methylidene-5-oxatricyclo820046dodecan-4-ylmethanol.jpg "2D Structure of (12,12-Dimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecan-4-yl)methanol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.62% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.09% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.81% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 92.04% | 95.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.38% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.68% | 97.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.38% | 95.38% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 84.36% | 98.10% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.21% | 95.89% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.16% | 96.21% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.73% | 95.50% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.51% | 89.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Betula pubescens |
| Euphorbia micractina |
| Juniperus chinensis |
| PubChem | 14733980 |
| LOTUS | LTS0135854 |
| wikiData | Q105215114 |